CAS Number922-68-9
SynonymsMethyl 2-oxoacetate; MFCD01631120; EINECS 213-084-0; Acetic acid, 2-oxo-, methyl ester; Methyl glyoxylate
Molecular FormulaC3H4O3
Molecular Weight217.22
Purity97%
Density1.1±0.1 g/cm3
Boiling Point102.6±23.0 °C at 760 mmHg
Melting Point96-100 °C (lit.)
Appearancecolorless transparent liquid
EINECS213-084-0
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 922-68-9 |
| Catalog No. | 2A-9008286 |
| Chinese Name | 乙醛酸甲酯 |
| Synonyms | Methyl 2-oxoacetate; MFCD01631120; EINECS 213-084-0; Acetic acid, 2-oxo-, methyl ester; Methyl glyoxylate |
| Molecular Formula | C3H4O3 |
| Molecular Weight | 217.22 |
| Purity | 97 |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 102.6±23.0 °C at 760 mmHg |
| Melting Point | 96-100 °C (lit.) |
| Appearance | colorless transparent liquid |
| EINECS | 213-084-0 |
| HTC | 2918300090 |
| PubChem ID | 24874518 |
| MDL Number | MFCD02683553 |
| SMILES | COC(=O)C(=O)c1cn(C)c2ccccc12 |
| InChI | 1S/C12H11NO3/c1-13-7-9(11(14)12(15)16-2)8-5-3-4-6-10(8)13/h3-7H,1-2H3 |
| InChI Key | SBHIWUQNUXJUMN-UHFFFAOYSA-N |
| NACRES Code | NA.22 |
| UNSPSC | 12352100 |
| MSDS | msds/8286_1_922_68_9.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives. Supervision conditions:None. VAT: 17.0%. Tax rebate rate:9.0%. MFN tariff: 6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Methyl dimethylbenzeneacetate | 2A-108281 | 2A-9008281 |
| Methyl DL-4-hydroxyphenylglycine | 2A-108282 | 2A-9008282 |
| Methyl furfuryl disulfide | 57500-00-2 | 2A-9008283 |
| Methyl gallate | 99-24-1 | 2A-9008284 |
| Methyl gentisate | 2150-46-1 | 2A-9008285 |
| Methyl isobutyl acetate | 540-42-1 | 2A-9008288 |
| Methyl isodehydroacetate | 41264-06-6 | 2A-9008289 |
| Methyl L-3-phenyllactate | 13673-95-5 | 2A-9008291 |
| Methyl Laurate | 111-82-0 | 2A-9008292 |
| Methyl myristate | 124-10-7 | 2A-9008293 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS