
CAS Number19339-59-4
SynonymsThiocyanic Acid 2-(4-Chlorophenyl)-2-Oxoethyl Ester; MFCD00019771; 4-Chlorophenacylthiocyanate; 1-(4-chlorophenyl)-2-thiocyanatoethanone; EINECS 242-972-0; [2-(4-chlorophenyl)-2-oxoethyl]thiocarbonitrile; 2-(4-Chlorophenyl)-2-oxoethyl thiocyanate; 4-CHLOROBENZOYLMETHYL THIOCYANATE; 4-Chlorophenacyl thiocyanate
Molecular FormulaC9H6ClNOS
Molecular Weight211.671
Density1.35g/cm3
Boiling Point381.3ºC at 760mmHg
Melting Point133-137 °C
AppearanceWhite to off-white needles or crystals
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 19339-59-4 |
| Catalog No. | 2A-9082782 |
| Chinese Name | 4-氯苯甲酰甲基硫氰酸酯 |
| Synonyms | Thiocyanic Acid 2-(4-Chlorophenyl)-2-Oxoethyl Ester; MFCD00019771; 4-Chlorophenacylthiocyanate; 1-(4-chlorophenyl)-2-thiocyanatoethanone; EINECS 242-972-0; [2-(4-chlorophenyl)-2-oxoethyl]thiocarbonitrile; 2-(4-Chlorophenyl)-2-oxoethyl thiocyanate; 4-CHLOROBENZOYLMETHYL THIOCYANATE; 4-Chlorophenacyl thiocyanate |
| Molecular Formula | C9H6ClNOS |
| Molecular Weight | 211.671 |
| Density | 1.35g/cm3 |
| Boiling Point | 381.3ºC at 760mmHg |
| Melting Point | 133-137 °C |
| Appearance | White to off-white needles or crystals |
| Storage Condition | Sealed in a cool, dry environment |
| HTC | 2930909090 |
| MDL Number | MFCD00019771 |
| SMILES | N#CSCC(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C9H6ClNOS/c10-8-3-1-7(2-4-8)9(12)5-13-6-11/h1-4H,5H2 |
| InChI Key | JSIQRJQKMVTGJN-UHFFFAOYSA-N |
| MSDS | msds/82782_1_19339_59_4.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2930909090. other organo-sulfur compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 7-(Methoxycarbonyl)-6,7-dihydro-5H-pyrrolizine-1-carboxylicacid | 92992-17-1 | 2A-9082769 |
| 2-(Cyclopropylmethoxy)benzonitrile | 83728-40-9 | 2A-9082774 |
| 4-(Isopropylamino)-3-nitrobenzonitrile | 355022-17-2 | 2A-9082776 |
| 2-Naphthoylmethylthiocyanate | 19339-62-9 | 2A-9082779 |
| 5-Amino-2H-isoquinoin-1-one | 93117-08-9 | 2A-9082780 |
| 4-Bromophenacylthiocyanate | 65679-14-3 | 2A-9082784 |
| p-Xylylenedithiocyanate | 1014-99-9 | 2A-9082788 |
| Ethylene1,2-dithiocyanate | 629-17-4 | 2A-9082790 |
| 4-(6-Methoxy-benzothiazol-2-ylcarbamoyl)-butyricacid | 436086-78-1 | 2A-9082791 |
| 1,1-Dicyano-2-methyl-1-propene | 13166-10-4 | 2A-9082793 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA