
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 1199-59-3 |
| Catalog No. | 2A-9082721 |
| Chinese Name | 4-二甲氨基邻甲苯醛 |
| Synonyms | 4-(dimethylamino)-2-methylbenzaldehyde; MFCD00043519; EINECS 214-846-5 |
| Molecular Formula | C10H13O1N1 |
| Molecular Weight | 163.22 |
| Density | 1.05g/cm3 |
| Boiling Point | 292.7ºC at 760 mmHg |
| Melting Point | 64-66ºC |
| Storage Condition | room temperature |
| HTC | 2922399090 |
| MDL Number | MFCD00043519 |
| SMILES | Cc1cc(N(C)C)ccc1C=O |
| InChI | InChI=1S/C10H13NO/c1-8-6-10(11(2)3)5-4-9(8)7-12/h4-7H,1-3H3 |
| InChI Key | XZWMCPUAUNHGPF-UHFFFAOYSA-N |
| MSDS | msds/82721_1_1199_59_3.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2922399090 other amino-aldehydes, amino-ketones and amino-quinones, other than those containing more than one kind of oxygen function; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| 4-(Trimethylsiloxy)benzaldehyde | 1012-12-0 | 2A-9082711 |
| 4-Butylbenzaldehyde | 1200-14-2 | 2A-9082716 |
| 4-N-Propylbenzaldehyde | 28785-06-0 | 2A-9082718 |
| 4-N-Hexylbenzaldehyde | 49763-69-1 | 2A-9082719 |
| 4-Octylbenzaldehyde | 49673-66-8 | 2A-9082720 |
| 4-Dodecyloxybenzaldehyde | 24083-19-0 | 2A-9082723 |
| 4-N-Pentylbenzaldehyde | 6853-57-2 | 2A-9082724 |
| 4-(2-Chloroethoxy)benzaldehyde | 54373-15-8 | 2A-9082726 |
| 4-Nonyloxybenzaldehyde | 50262-46-9 | 2A-9082729 |
| 6-Bromo-2-hydroxy-3-methoxybenzaldehyde | 20035-41-0 | 2A-9082733 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA