
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 1200-14-2 |
| Catalog No. | 2A-9082716 |
| Chinese Name | 对丁基苯甲醛 |
| Synonyms | EINECS 214-851-2; 4-n-Butylbenzaldehyde; 4-Butylbenzaldehyde; MFCD00040751 |
| Molecular Formula | (CH3)3CC6H4CHO |
| Molecular Weight | 162.23 |
| Purity | 97 |
| Density | 1.0±0.1 g/cm3 |
| Boiling Point | 130 °C/25 mmHg (lit.) |
| Melting Point | -43°C |
| Appearance | liquid |
| Storage Condition | Keep the container sealed and stored in a cool, dr |
| EINECS | 213-367-9 |
| HTC | 2912299000 |
| PubChem ID | 24863644 |
| MDL Number | MFCD00035742 |
| SMILES | [H]C(=O)c1ccc(cc1)C(C)(C)C |
| InChI | 1S/C11H14O/c1-11(2,3)10-6-4-9(8-12)5-7-10/h4-8H,1-3H3 |
| InChI Key | OTXINXDGSUFPNU-UHFFFAOYSA-N |
| Beilstein/REAXYS | 1906461 |
| NACRES Code | NA.22 |
| UNSPSC | 12352100 |
| MSDS | msds/82716_1_1200_14_2.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 5.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Purity: 95.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| 4-Chloro-2,6-difluorophenylboronicacid | 925911-61-1 | 2A-9082698 |
| 4-Hexyloxybenzaldehyde | 5736-94-7 | 2A-9082703 |
| 2-(Tert-Butylthio)benzaldehyde | 65924-65-4 | 2A-9082709 |
| 2-(Trimethylsiloxy)benzaldehyde | 1078-31-5 | 2A-9082710 |
| 4-(Trimethylsiloxy)benzaldehyde | 1012-12-0 | 2A-9082711 |
| 4-N-Propylbenzaldehyde | 28785-06-0 | 2A-9082718 |
| 4-N-Hexylbenzaldehyde | 49763-69-1 | 2A-9082719 |
| 4-Octylbenzaldehyde | 49673-66-8 | 2A-9082720 |
| 4-Dimethylamino-2-methylbenzaldehyde | 1199-59-3 | 2A-9082721 |
| 4-Dodecyloxybenzaldehyde | 24083-19-0 | 2A-9082723 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA