
CAS Number4309-82-4
Synonyms2-Formamido-4-(methylsulfanyl)butanoic acid; FORMYL-L-METHIONINE; FORMYL-DL-METHIONINE; 2-formylamino-4-(methylthio)butanoic acid; N-Formyl-DL-methionine; DL-2-Formamino-4-methylmercapto-buttersaeure; 2-formamido-4-(methylthio)butyric acid; N-Formyl-methionin; EINECS 224-322-8; FMET; N-formyl dl-methionine; N-Formylmethionine; N-formyl-methionine
Molecular FormulaC6H11O3N1S1
Molecular Weight177.22
Density1.2±0.1 g/cm3
Boiling Point453.5±40.0 °C at 760 mmHg
Melting Point103ºC
AppearanceWhite-off-white crystal-powder
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 4309-82-4 |
| Catalog No. | 2A-9082558 |
| Chinese Name | N-甲酰基-DL-蛋氨酸 |
| Synonyms | 2-Formamido-4-(methylsulfanyl)butanoic acid; FORMYL-L-METHIONINE; FORMYL-DL-METHIONINE; 2-formylamino-4-(methylthio)butanoic acid; N-Formyl-DL-methionine; DL-2-Formamino-4-methylmercapto-buttersaeure; 2-formamido-4-(methylthio)butyric acid; N-Formyl-methionin; EINECS 224-322-8; FMET; N-formyl dl-methionine; N-Formylmethionine; N-formyl-methionine |
| Molecular Formula | C6H11O3N1S1 |
| Molecular Weight | 177.22 |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 453.5±40.0 °C at 760 mmHg |
| Melting Point | 103ºC |
| Appearance | White-off-white crystal-powder |
| Storage Condition | Keep away from light, in a ventilated and dry plac |
| HTC | 2930909090 |
| MDL Number | MFCD00063284 |
| SMILES | CSCCC(NC=O)C(=O)O |
| InChI | InChI=1S/C6H11NO3S/c1-11-3-2-5(6(9)10)7-4-8/h4-5H,2-3H2,1H3,(H,7,8)(H,9,10) |
| InChI Key | PYUSHNKNPOHWEZ-UHFFFAOYSA-N |
| MSDS | msds/82558_1_4309_82_4.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Purity: 99.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 3-(Aminomethyl)-benzoicacidethylesterhydrochloride | 91843-34-4 | 2A-9082548 |
| L-Ascorbicacid-2-phosphatemagnesiumsalt | 84309-23-9 | 2A-9082550 |
| N-Formylglycinemethylester | 3154-54-9 | 2A-9082553 |
| N-Formyl-DL-alanine | 5893-10-7 | 2A-9082555 |
| N-Formyl-L-alanine | 10512-86-4 | 2A-9082556 |
| N-Formyl-L-methionine | 4289-98-9 | 2A-9082560 |
| 5-Pyridin-4-yl-2H-pyrazol-3-ylamine | 91912-53-7 | 2A-9082561 |
| N-Formyl-D-phenylalanine | 59366-89-1 | 2A-9082563 |
| 1-Iodo-4-ethoxy-benzene | 91912-54-8 | 2A-9082564 |
| N-Formyl-L-histidine | 15191-21-6 | 2A-9082567 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA