
CAS Number773-64-8
SynonymsMFCD00007434; mesitylene-2-sulfonyl chloride; EINECS 212-257-8; 2,4,6-Trimethylbenzenesulfonyl chloride
Molecular Formula(CH3)3C6H2SO2Cl
Molecular Weight218.70
Purity99%
Density1.3±0.1 g/cm3
Boiling Point303.1±41.0 °C at 760 mmHg
Melting Point55-57 °C (lit.)
Appearancecrystals
EINECS212-257-8
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 773-64-8 |
| Catalog No. | 2A-9008191 |
| Chinese Name | 2,4,6-三甲基苯磺酰氯 |
| Synonyms | MFCD00007434; mesitylene-2-sulfonyl chloride; EINECS 212-257-8; 2,4,6-Trimethylbenzenesulfonyl chloride |
| Molecular Formula | (CH3)3C6H2SO2Cl |
| Molecular Weight | 218.70 |
| Purity | 99 |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 303.1±41.0 °C at 760 mmHg |
| Melting Point | 55-57 °C (lit.) |
| Appearance | crystals |
| Water Solubility | insoluble |
| Storage Condition | It should be used and stored in a nitrogen atmosph |
| Packaging | II |
| EINECS | 212-257-8 |
| HTC | 29309070 |
| PubChem ID | 24897176 |
| MDL Number | MFCD00007434 |
| SMILES | Cc1cc(C)c(c(C)c1)S(Cl)(=O)=O |
| InChI | 1S/C9H11ClO2S/c1-6-4-7(2)9(8(3)5-6)13(10,11)12/h4-5H,1-3H3 |
| InChI Key | PVJZBZSCGJAWNG-UHFFFAOYSA-N |
| Beilstein/REAXYS | 1107601 |
| NACRES Code | NA.22 |
| UNSPSC | 12352100 |
| Hazard Symbols | 8 |
| MSDS | msds/8191_1_773_64_8.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Purity: 99.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: Class 8 Corrosives UN number: 3261 Proper shipping name: Corrosive solid, acidic, organic, not otherwise specified Packing grade: II |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Menadiol diacetate | 573-20-6 | 2A-9008185 |
| Menadione | 58-27-5 | 2A-9008186 |
| Menthyl acetate | 89-48-5 | 2A-9008187 |
| Mepirizole | 18694-40-1 | 2A-9008188 |
| Mepronil | 55814-41-0 | 2A-9008189 |
| Mestanolone | 521-11-9 | 2A-9008192 |
| Metaproterenol sulfate | 5874-97-5 | 2A-9008194 |
| Methacrylatoethyl trimethyl ammonium chloride | 5039-78-1 | 2A-9008195 |
| Methandienone | 72-63-9 | 2A-9008196 |
| Methenolone | 153-00-4 | 2A-9008197 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA