![1-(2'-Fluoro[1,1'-biphenyl]-4-yl)propan-1-one structure, CAS 37989-92-7](/structures/100000/81900_1_37989_92_7.png)
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 37989-92-7 |
| Catalog No. | 2A-9081900 |
| Chinese Name | 4'-(2-氟苯基)苯丙酮 |
| Synonyms | 1-(2′-Fluoro[1,1′-biphenyl]-4-yl)propan-1-one; MFCD00236612; 1-[4-(2-fluorophenyl)phenyl]propan-1-one |
| Molecular Formula | C17H18O1 |
| Molecular Weight | 238.33 |
| Density | 1.102g/cm3 |
| Boiling Point | 334.1ºC at 760mmHg |
| Melting Point | 76-77ºC |
| Storage Condition | room temperature, dry |
| HTC | 2914700090 |
| MDL Number | MFCD34705896 |
| SMILES | CCC(=O)c1ccc(-c2ccccc2F)cc1 |
| InChI Key | ZXIQZWXVSBJPTC-UHFFFAOYSA-N |
| MSDS | msds/81900_1_37989_92_7.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2-Bromo-1-(4-fluorophenyl)-2-phenylethanone | 88675-31-4 | 2A-9081893 |
| 2-Bromo-5-fluorophenylacetonitrile | 886761-96-2 | 2A-9081894 |
| 2-Fluoro-6-iodoaniline | 886762-73-8 | 2A-9081895 |
| 5-Fluorophtalicacid | 1583-66-0 | 2A-9081897 |
| 6-Fluoro-2-tetralone | 294919-14-5 | 2A-9081899 |
| 3'-Bromo-4'-fluoropropiophenone | 202865-82-5 | 2A-9081901 |
| 3,4-Difluoropropiophenone | 23384-72-7 | 2A-9081907 |
| 1,1,1-Trifluoro-2-phenyl-3-butyn-2-ol | 99727-20-5 | 2A-9081922 |
| 4-Hydroxy-4'-isopropoxydiphenylsulfone | 85235-80-6 | 2A-9081926 |
| 1-(Morpholin-4-yl)-2-hydroxycyclopentane | 161193-34-6 | 2A-9081929 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA