
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 88675-31-4 |
| Catalog No. | 2A-9081893 |
| Chinese Name | 2-溴-1-(4-氟苯基)-2-苯乙酮 |
| Synonyms | 2-Bromo-2-phenyl-1-(4-fluorophenyl)-ethanone; 2-Bromo-1-(4-fluorophenyl)-2-phenyl-Ethanone; QC-4247 |
| Molecular Formula | C14H10BrFO |
| Molecular Weight | 293.13100 |
| Boiling Point | 356.4±27.0°C at 760 mmHg |
| Storage Condition | 2-8°C, store in inert gas |
| HTC | 2914700090 |
| SMILES | O=C(c1ccc(F)cc1)C(Br)c1ccccc1 |
| InChI Key | DYTDDALWSRMTDA-UHFFFAOYSA-N |
| MSDS | msds/81893_1_88675_31_4.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2-Fluoro-5-(trifluoromethoxy)benzonitrile | 886498-08-4 | 2A-9081881 |
| 3-Fluoro-4-(trifluoromethoxy)benzoicacid | 886498-89-1 | 2A-9081882 |
| 3-Fluoro-4-(trifluoromethoxy)benzylamine | 886499-13-4 | 2A-9081884 |
| 2-Chloro-6-fluoro-3-methylbenzonitrile | 886500-98-7 | 2A-9081887 |
| 4-Bromo-5-fluoro-2-methoxyphenol | 886510-25-4 | 2A-9081888 |
| 2-Bromo-5-fluorophenylacetonitrile | 886761-96-2 | 2A-9081894 |
| 2-Fluoro-6-iodoaniline | 886762-73-8 | 2A-9081895 |
| 5-Fluorophtalicacid | 1583-66-0 | 2A-9081897 |
| 6-Fluoro-2-tetralone | 294919-14-5 | 2A-9081899 |
| 1-(2'-Fluoro[1,1'-biphenyl]-4-yl)propan-1-one | 37989-92-7 | 2A-9081900 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA