
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 652-22-2 |
| Catalog No. | 2A-9081773 |
| Chinese Name | 全氟苯乙酮 |
| Synonyms | MFCD00216596; 2,2,2-trifluoro-1-(2,3,4,5,6-pentafluorophenyl)ethanone |
| Molecular Formula | C8O1F8 |
| Molecular Weight | 264.07 |
| Density | 1.609 g/mL at 25ºC(lit.) |
| Boiling Point | 176.8ºC at 760 mmHg |
| Appearance | Colorless to yellow liquid |
| Storage Condition | Room temperature, avoid light, ventilated and dry |
| HTC | 2914700090 |
| MDL Number | MFCD00216596 |
| SMILES | O=C(c1c(F)c(F)c(F)c(F)c1F)C(F)(F)F |
| InChI | InChI=1S/C8F8O/c9-2-1(7(17)8(14,15)16)3(10)5(12)6(13)4(2)11 |
| InChI Key | IIDKLGQPNPUKBQ-UHFFFAOYSA-N |
| MSDS | msds/81773_1_652_22_2.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| (1,2,3,4-Tetrahydroisoquinolin-6-yl)carbamicacidtert-butylester | 885273-75-6 | 2A-9081761 |
| 4-Chloro-2,5-difluoroacetophenone | 655-12-9 | 2A-9081764 |
| 3,4,5-Trifluoroacetophenone | 220141-73-1 | 2A-9081765 |
| 1-(4-Dimethylaminophenyl)-2,2,2-trifluoroethanone | 2396-05-6 | 2A-9081766 |
| 3-(pentafluorophenyl)-1-propene | 1736-60-3 | 2A-9081767 |
| 2-(Trifluoromethoxy)acetophenone | 220227-93-0 | 2A-9081775 |
| 2-Bromo-6-methyl-nicotinicacidmethylester | 885277-48-5 | 2A-9081779 |
| 5-Fluoro-2-methoxyacetophenone | 445-82-9 | 2A-9081780 |
| 2',4'-Dimethoxy-2,2,2-trifluoroacetophenone | 578-16-5 | 2A-9081783 |
| 2-Hydroxy-5-(trifluoromethoxy)acetophenone | 146575-64-6 | 2A-9081784 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA