
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 220141-73-1 |
| Catalog No. | 2A-9081765 |
| Chinese Name | 3,4,5-三氟苯乙酮 |
| Synonyms | MFCD00083533; 1-(3,4,5-Trifluorophenyl)ethan-1-one; FR BF CF EV1; 1-acetyl-3,4,5-trifluorobenzene; 1-(3,4,5-Trifluorophenyl)ethanone |
| Molecular Formula | C8H5O1F3 |
| Molecular Weight | 174.12 |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 208.8±35.0 °C at 760 mmHg |
| Storage Condition | Storage method: airtight, cool, ventilated and dry |
| HTC | 2914700090 |
| MDL Number | MFCD00083533 |
| SMILES | CC(=O)c1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C8H5F3O/c1-4(12)5-2-6(9)8(11)7(10)3-5/h2-3H,1H3 |
| InChI Key | KXVIYAHOUAMVJX-UHFFFAOYSA-N |
| MSDS | msds/81765_1_220141_73_1.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 6-Fluoro-1,2,3,4-tetrahydronaphthalene-2-carboxylicacid | 885269-59-0 | 2A-9081748 |
| Tert-butyl1,2,3,4-tetrahydroisoquinolin-7-ylcarbamate | 885270-54-2 | 2A-9081751 |
| 7-Amino-1,2-dihydroisoquinolin-3-(4H)-one | 885270-67-7 | 2A-9081752 |
| (1,2,3,4-Tetrahydroisoquinolin-6-yl)carbamicacidtert-butylester | 885273-75-6 | 2A-9081761 |
| 4-Chloro-2,5-difluoroacetophenone | 655-12-9 | 2A-9081764 |
| 1-(4-Dimethylaminophenyl)-2,2,2-trifluoroethanone | 2396-05-6 | 2A-9081766 |
| 3-(pentafluorophenyl)-1-propene | 1736-60-3 | 2A-9081767 |
| Octafluoroacetophenone | 652-22-2 | 2A-9081773 |
| 2-(Trifluoromethoxy)acetophenone | 220227-93-0 | 2A-9081775 |
| 2-Bromo-6-methyl-nicotinicacidmethylester | 885277-48-5 | 2A-9081779 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA