
CAS Number2892-29-7
Synonyms2-Chloro-4-acetylphenol; 1-(3-Chloro-4-hydroxyphenyl)-1-ethanone; 1-(3-Chlor-4-hydroxy-phenyl)-aethanon; chlorohydroxyphenylethanone; 4-acetyl-2-chlorophenol; 1-acetyl-3-chloro-4-hydroxybenzene; 1-(3-chloro-4-hydroxy-phenyl)-ethanone
Molecular Formula4-(Cl)-3-(CH3)C6H3OH
Molecular Weight142.58
Purity≥99.0 (GC)%
Density1.298 g/cm3
Boiling Point235-239 °C/1013 hPa
Melting Point63-65 °C
Appearancepowder
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 2892-29-7 |
| Catalog No. | 2A-9081715 |
| Chinese Name | 3'-氯-4'-羟基苯乙酮 |
| Synonyms | 2-Chloro-4-acetylphenol; 1-(3-Chloro-4-hydroxyphenyl)-1-ethanone; 1-(3-Chlor-4-hydroxy-phenyl)-aethanon; chlorohydroxyphenylethanone; 4-acetyl-2-chlorophenol; 1-acetyl-3-chloro-4-hydroxybenzene; 1-(3-chloro-4-hydroxy-phenyl)-ethanone |
| Molecular Formula | 4-(Cl)-3-(CH3)C6H3OH |
| Molecular Weight | 142.58 |
| Purity | ≥99.0 (GC) |
| Density | 1.298 g/cm3 |
| Boiling Point | 235-239 °C/1013 hPa |
| Melting Point | 63-65 °C |
| Appearance | powder |
| Storage Condition | room temperature |
| HTC | 2914700090 |
| MDL Number | MFCD00002323 |
| SMILES | Clc1c(cc(cc1)O)C |
| InChI | 1S/C7H7ClO/c1-5-4-6(9)2-3-7(5)8/h2-4,9H,1H3 |
| InChI Key | CFKMVGJGLGKFKI-UHFFFAOYSA-N |
| NACRES Code | NA.22 |
| UNSPSC | 12352104 |
| MSDS | msds/81715_1_2892_29_7.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 5-Phenyl-4-pentyn-1-ol | 24595-58-2 | 2A-9081707 |
| 2-Bromo-2',4'-dihydroxyacetophenone | 2491-39-6 | 2A-9081709 |
| 1-(4-Chlorophenyl)-2-hydroxy-1-ethanone | 27993-56-2 | 2A-9081711 |
| 5'-Chloro-2'-hydroxy-4'-methylacetophenone | 28480-70-8 | 2A-9081713 |
| 2-Fluoro-5-formyl-3-picoline | 884495-04-9 | 2A-9081714 |
| 1,4-Bis(1-Methyl-1-hydroxyethyl)benzene | 2948-46-1 | 2A-9081716 |
| 5-Chloro-N,2-dihydroxybenzamide | 37551-43-2 | 2A-9081717 |
| N,N'-Disalicylal-1,2-phenylenediamine | 3946-91-6 | 2A-9081720 |
| 4-Hydroxy-2'-nitrobiphenyl | 51264-59-6 | 2A-9081721 |
| 4-tert-Butyl-2-phenylphenol | 577-92-4 | 2A-9081722 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA