
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 27993-56-2 |
| Catalog No. | 2A-9081711 |
| Chinese Name | 2'-羟基-4-氯苯乙酮 |
| Synonyms | 1-(4-chlorophenyl)-2-hydroxyethanone |
| Molecular Formula | C14H10BrClO |
| Molecular Weight | 170.59300 |
| Density | 1.307g/cm3 |
| Boiling Point | 299.9ºC at 760 mmHg |
| Melting Point | 127-129ºC |
| Storage Condition | Room temperature, sealed, dry |
| HTC | 2914700090 |
| SMILES | O=C(CC1=CC=C(Br)C=C1)C2=CC=C(Cl)C=C2 |
| InChI | 1S/C14H10BrClO/c15-12-5-1-10(2-6-12)9-14(17)11-3-7-13(16)8-4-11/h1-8H,9H2 |
| InChI Key | HROHCBQZYJVQSK-UHFFFAOYSA-N |
| UNSPSC | 12352100 |
| MSDS | msds/81711_1_27993_56_2.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2-Hydroxy-2'-methoxyacetophenone | 224321-19-1 | 2A-9081703 |
| 4-Nitro-2,6-diphenylphenol | 2423-73-6 | 2A-9081705 |
| 2-Methyl-6-fluoro-3-nicotinicacid | 884494-97-7 | 2A-9081706 |
| 5-Phenyl-4-pentyn-1-ol | 24595-58-2 | 2A-9081707 |
| 2-Bromo-2',4'-dihydroxyacetophenone | 2491-39-6 | 2A-9081709 |
| 5'-Chloro-2'-hydroxy-4'-methylacetophenone | 28480-70-8 | 2A-9081713 |
| 2-Fluoro-5-formyl-3-picoline | 884495-04-9 | 2A-9081714 |
| 3'-Chloro-4'-hydroxyacetophenone | 2892-29-7 | 2A-9081715 |
| 1,4-Bis(1-Methyl-1-hydroxyethyl)benzene | 2948-46-1 | 2A-9081716 |
| 5-Chloro-N,2-dihydroxybenzamide | 37551-43-2 | 2A-9081717 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA