
CAS Number17044-70-1
SynonymsEINECS 241-113-7; 1-(3,5-Dichloro-4-hydroxyphenyl)ethanone; 1-(3,5-Dichlor-4-hydroxy-phenyl)-aethanon; 1-(3,5-dichloro-4-hydroxy-phenyl)-ethanone; 2,6-dichloro-4-acetylphenol; 2,6-dichloro-4-methylcarbonylphenol
Molecular FormulaC8H6Cl2O2
Molecular Weight205.04
Density1.4±0.1 g/cm3
Boiling Point335.5±42.0 °C at 760 mmHg
Appearancesolid
EINECS241-113-7
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 17044-70-1 |
| Catalog No. | 2A-9081653 |
| Chinese Name | 3',5'-二氯-4'-羟基乙酰苯 |
| Synonyms | EINECS 241-113-7; 1-(3,5-Dichloro-4-hydroxyphenyl)ethanone; 1-(3,5-Dichlor-4-hydroxy-phenyl)-aethanon; 1-(3,5-dichloro-4-hydroxy-phenyl)-ethanone; 2,6-dichloro-4-acetylphenol; 2,6-dichloro-4-methylcarbonylphenol |
| Molecular Formula | C8H6Cl2O2 |
| Molecular Weight | 205.04 |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 335.5±42.0 °C at 760 mmHg |
| Appearance | solid |
| Storage Condition | room temperature, dry |
| EINECS | 241-113-7 |
| HTC | 2914700090 |
| PubChem ID | 329815494 |
| MDL Number | MFCD00016421 |
| SMILES | CC(=O)c1cc(Cl)c(O)c(Cl)c1 |
| InChI | 1S/C8H6Cl2O2/c1-4(11)5-2-6(9)8(12)7(10)3-5/h2-3,12H,1H3 |
| InChI Key | FXSIZYWHUQEXPC-UHFFFAOYSA-N |
| NACRES Code | NA.21 |
| UNSPSC | 12352200 |
| MSDS | msds/81653_1_17044_70_1.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 5-Ethoxy-6-Methylpyridin-2-amine | 73101-79-8 | 2A-9081645 |
| Dimethylpropiothetin | 7314-30-9 | 2A-9081647 |
| N,N-Bis(2,5-Dihydroxybenzylidene)ethylenediamine | 124061-43-4 | 2A-9081650 |
| 3',5'-Di-Tert-Butyl-4'-hydroxyacetophenone | 14035-33-7 | 2A-9081651 |
| 2,6-Dibromo-3-methyl-4-nitrophenol | 14401-03-7 | 2A-9081652 |
| 4',5'-Dimethoxy-2'-hydroxyacetophenone | 20628-06-2 | 2A-9081654 |
| 5'-Ethyl-2'-hydroxyacetophenone | 24539-92-2 | 2A-9081655 |
| 2-(1,3-Dithiolan-2-yl)-4-nitrophenol | 261704-15-8 | 2A-9081656 |
| 2,5-Dinitrophenol | 329-71-5 | 2A-9081657 |
| 9-Hydroxy-n-nonanoicacidmethylester | 34957-73-8 | 2A-9081658 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA