
CAS Number124061-43-4
SynonymsN,N'-Ethylenebis(5-hydroxysalicylideneimine); N,N'-Bis(5-hydroxysalicylidene)ethylenediaMine; N,N-Bis(2,5-dihydroxybenzylidene)ethylenediamine; 5,5'-dihydroxysalen; 5,5'-DIHYDROXYSALICYLALDEHYDETHYLENEDIIMINE
Molecular FormulaC16H16O4N2
Molecular Weight300.31
Density1.559g/cm3
Boiling Point481.8ºC at 760mmHg
Melting Point125-127ºC
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 124061-43-4 |
| Catalog No. | 2A-9081650 |
| Chinese Name | N,N'-双(5-羟基亚水杨基)乙二胺 |
| Synonyms | N,N'-Ethylenebis(5-hydroxysalicylideneimine); N,N'-Bis(5-hydroxysalicylidene)ethylenediaMine; N,N-Bis(2,5-dihydroxybenzylidene)ethylenediamine; 5,5'-dihydroxysalen; 5,5'-DIHYDROXYSALICYLALDEHYDETHYLENEDIIMINE |
| Molecular Formula | C16H16O4N2 |
| Molecular Weight | 300.31 |
| Density | 1.559g/cm3 |
| Boiling Point | 481.8ºC at 760mmHg |
| Melting Point | 125-127ºC |
| Storage Condition | Keep the container sealed and stored in a cool, dr |
| HTC | 2925290090 |
| MDL Number | MFCD04039747 |
| SMILES | Oc1ccc(O)c(C=NCCN=Cc2cc(O)ccc2O)c1 |
| InChI Key | KQVXRKRRCLZZKX-UHFFFAOYSA-N |
| MSDS | msds/81650_1_124061_43_4.pdf |
| Tax Rebate | 9.0% |
| Supervision | none |
| Transport Info | Product name: Purity: 98.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards N,N'-bis(5-hydroxysalicylidene)ethylenediamine Modification number: 5 Module 14. Shipping information UN number: not specified |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| N1-(3-Acetyl-4-hydroxyphenyl)acetamide | 7298-67-1 | 2A-9081642 |
| Cis-10-Nonadecenoicacid | 73033-09-7 | 2A-9081643 |
| 2-(1-Phenylcyclobutyl)aceticacid | 7306-17-4 | 2A-9081644 |
| 5-Ethoxy-6-Methylpyridin-2-amine | 73101-79-8 | 2A-9081645 |
| Dimethylpropiothetin | 7314-30-9 | 2A-9081647 |
| 3',5'-Di-Tert-Butyl-4'-hydroxyacetophenone | 14035-33-7 | 2A-9081651 |
| 2,6-Dibromo-3-methyl-4-nitrophenol | 14401-03-7 | 2A-9081652 |
| 3',5'-Dichloro-4'-hydroxyacetophenone | 17044-70-1 | 2A-9081653 |
| 4',5'-Dimethoxy-2'-hydroxyacetophenone | 20628-06-2 | 2A-9081654 |
| 5'-Ethyl-2'-hydroxyacetophenone | 24539-92-2 | 2A-9081655 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA