
CAS Number2394-20-9
SynonymsDL-4-Hydroxy-3-MethoxyMandelic Acid; EINECS 200-224-0; MFCD00004235
Molecular FormulaHOC6H3(OCH3)CH(OH)CO2H
Molecular Weight198.17
Purity≥98.0 (GC)%
Density1.44g/cm3
Boiling Point421.3ºC at 760 mmHg
Melting Point132-134 °C (dec.) (lit.)
Appearancepowder | white to off-white
EINECS200-224-0
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 2394-20-9 |
| Catalog No. | 2A-9081612 |
| Chinese Name | 4-羟基-3-甲氧基-DL-扁桃酸 |
| Synonyms | DL-4-Hydroxy-3-MethoxyMandelic Acid; EINECS 200-224-0; MFCD00004235 |
| Molecular Formula | HOC6H3(OCH3)CH(OH)CO2H |
| Molecular Weight | 198.17 |
| Purity | ≥98.0 (GC) |
| Density | 1.44g/cm3 |
| Boiling Point | 421.3ºC at 760 mmHg |
| Melting Point | 132-134 °C (dec.) (lit.) |
| Appearance | powder | white to off-white |
| Water Solubility | H2O: ~50 mg/mL |
| Storage Condition | Storage temperature 2-8°. Keep container sealed, p |
| EINECS | 200-224-0 |
| HTC | 2918990090 |
| PubChem ID | 329764938 |
| MDL Number | MFCD00004235 |
| SMILES | OC1=C(OC)C=C(C(O)C(O)=O)C=C1 |
| InChI | 1S/C9H10O5/c1-14-7-4-5(2-3-6(7)10)8(11)9(12)13/h2-4,8,10-11H,1H3,(H,12,13) |
| InChI Key | CGQCWMIAEPEHNQ-UHFFFAOYSA-N |
| Beilstein/REAXYS | 2213227 |
| NACRES Code | NA.24 |
| UNSPSC | 41116107 |
| MSDS | msds/81612_1_2394_20_9.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 1,1-Dimethoxy-3-nitro-propane | 72447-81-5 | 2A-9081602 |
| 2-(Dimethylamino)pyrimidin-5-ol | 72491-71-5 | 2A-9081604 |
| 2-Acetoxyacetophenone | 7250-94-4 | 2A-9081605 |
| DL-3,4-Dihydroxymandelicacid | 14883-87-5 | 2A-9081608 |
| 2,3-Dimethyl-4-nitrophenol | 19499-93-5 | 2A-9081611 |
| Xylidineponceau2R | 3761-53-3 | 2A-9081616 |
| 4-Hydroxy-4'-nitrobiphenyl | 3916-44-7 | 2A-9081617 |
| 2-Hydroxy-3-methylbutyricacid | 4026-18-0 | 2A-9081618 |
| Hydroxybrasilein | 475-25-2 | 2A-9081619 |
| Purpurogallin | 569-77-7 | 2A-9081620 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA