
CAS Number615-62-3
Synonyms3-chloro-4-methyl-phenol; 3-Chlor-4-methyl-phenol; 3-Chloro-4-methylphenol; p-Cresol,3-chloro; 3-Chlor-p-kresol; 3-chloro-p-cresol; 2-chloro-4-hydroxytoluene; MFCD00060319; EINECS 210-439-1; Phenol,3-chloro-4-methyl; 2-Chlor-4-hydroxy-toluol; 2-Chlor-4-oxy-1-methyl-benzol
Molecular Formula4-(Cl)-3-(CH3)C6H3OH
Molecular Weight142.58
Purity≥99.0 (GC)%
Density1.2±0.1 g/cm3
Boiling Point235-239 °C/1013 hPa
Melting Point63-65 °C
Appearancepowder
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 615-62-3 |
| Catalog No. | 2A-9081436 |
| Chinese Name | 3-氯-4-甲基苯酚 |
| Synonyms | 3-chloro-4-methyl-phenol; 3-Chlor-4-methyl-phenol; 3-Chloro-4-methylphenol; p-Cresol,3-chloro; 3-Chlor-p-kresol; 3-chloro-p-cresol; 2-chloro-4-hydroxytoluene; MFCD00060319; EINECS 210-439-1; Phenol,3-chloro-4-methyl; 2-Chlor-4-hydroxy-toluol; 2-Chlor-4-oxy-1-methyl-benzol |
| Molecular Formula | 4-(Cl)-3-(CH3)C6H3OH |
| Molecular Weight | 142.58 |
| Purity | ≥99.0 (GC) |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 235-239 °C/1013 hPa |
| Melting Point | 63-65 °C |
| Appearance | powder |
| Storage Condition | Storage: Seal the container and store it in a seal |
| Packaging | II |
| HTC | 2908199090 |
| MDL Number | MFCD00002323 |
| SMILES | Clc1c(cc(cc1)O)C |
| InChI | 1S/C7H7ClO/c1-5-4-6(9)2-3-7(5)8/h2-4,9H,1H3 |
| InChI Key | CFKMVGJGLGKFKI-UHFFFAOYSA-N |
| NACRES Code | NA.22 |
| UNSPSC | 12352104 |
| Hazard Symbols | 6.1 |
| MSDS | msds/81436_1_615_62_3.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2908199090. Derivatives of polyphenols or phenol-alcohols containing only halogen substituents and their salts. VAT:17.0%. tax rebate rate:9.0%. supervision conditions:None. MFN tariff:5.5%. general tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| DL-Alanyl-DL-asparagine | 1999-41-3 | 2A-9081429 |
| 1-Benzyloxy-3-Methyl-2-nitrobenzene | 61535-21-5 | 2A-9081430 |
| 2-(2-Amino-propionylamino)-4-methylsulfanyl-butyricacid | 1999-43-5 | 2A-9081432 |
| DL-Alanyl-DL-norleucine | 19079-66-4 | 2A-9081433 |
| 2-Amino-3-fluorobutyricacid | 50885-01-3 | 2A-9081435 |
| 2-Amino-2-norbornanecarboxylicacid | 20448-79-7 | 2A-9081437 |
| 1,4-Dibenzoyl-1,4-dibromobutane | 71225-00-8 | 2A-9081438 |
| DL-4-Chlorophenylalanineethylesterhydrochloride | 52031-05-7 | 2A-9081445 |
| 5-Pyrrolidinoamylamine | 71302-71-1 | 2A-9081446 |
| 2-Thiophenamine | 616-46-6 | 2A-9081449 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA