
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 1128-28-5 |
| Catalog No. | 2A-9081164 |
| Chinese Name | 4-氨基-2-异丙基-5-甲基苯酚 |
| Synonyms | EINECS 214-436-6; 4-Amino-2-isopropyl-5-methylphenol; aminothymol; 4-aminothymol; 6-Amino-3-oxy-p-cymol |
| Molecular Formula | C10H15NO |
| Molecular Weight | 165.237 |
| Density | 1.055g/cm3 |
| Boiling Point | 304.6ºC at 760mmHg |
| Storage Condition | 2-8°C, protect from light, stored under nitrogen |
| HTC | 2922299090 |
| MDL Number | MFCD00130027 |
| SMILES | Cc1cc(O)c(C(C)C)cc1N |
| InChI | InChI=1S/C10H15NO/c1-6(2)8-5-9(11)7(3)4-10(8)12/h4-6,12H,11H2,1-3H3 |
| InChI Key | RGRUKJFIPJHWNL-UHFFFAOYSA-N |
| MSDS | msds/81164_1_1128_28_5.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| O-Benzyl-L-threonine | 4378-10-3 | 2A-9081152 |
| DL-3-Hydroxykyunrenine | 2147-61-7 | 2A-9081154 |
| 3-Iodo-4-methylaniline | 35944-64-0 | 2A-9081155 |
| 3-(4-methylpiperidin-1-yl)propan-1-amine | 6241-30-1 | 2A-9081161 |
| 4-Propylpyridin-2-ylamine | 61702-15-6 | 2A-9081163 |
| 5-(N-Ethyl-N-Isopropyl)Amiloride | 1154-25-2 | 2A-9081165 |
| GlycineN-propylesterhydrochloride | 13049-01-9 | 2A-9081166 |
| 3-Methyl-4-isopropylanilinehydrochloride | 4534-11-6 | 2A-9081167 |
| 3-(3,5-dimethyl-1H-pyrazol-1-yl)propan-1-amine | 62821-89-0 | 2A-9081171 |
| 5-Propyl[1,3,4]thiadiazol-2-ylamine | 39223-04-6 | 2A-9081172 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA