
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 261762-46-3 |
| Catalog No. | 2A-9080937 |
| Chinese Name | 3-氯-2,6-二氟苄胺 |
| Synonyms | 3-Chloro-2,6-difluorobenzylamine; MFCD01631388 |
| Molecular Formula | C7H6ClF2N |
| Molecular Weight | 177.57900 |
| Density | 1.368g/cm3 |
| Boiling Point | 212ºC at 760 mmHg |
| Storage Condition | Storage method: airtight, cool, ventilated and dry |
| Packaging | III |
| HTC | 2921499090 |
| SMILES | NCc1c(F)ccc(Cl)c1F |
| InChI | InChI=1S/C7H6ClF2N/c8-5-1-2-6(9)4(3-11)7(5)10/h1-2H,3,11H2 |
| InChI Key | VKKBGPPYRLLFIL-UHFFFAOYSA-N |
| Hazard Symbols | 8 |
| MSDS | msds/80937_1_261762_46_3.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2921499090 other aromatic monoamines and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 1-Bromo-propene | 590-13-6 | 2A-9080926 |
| 5-Bromo-1H-indol-3-amine | 69343-99-3 | 2A-9080928 |
| 6-Benzoyl-2-naphthol | 52222-87-4 | 2A-9080929 |
| Ethyl-alpha-cyano-4-hydroxycinnamate | 6935-44-0 | 2A-9080930 |
| 4-(4-Nitrophenylazo)-1-naphthol | 5290-62-0 | 2A-9080935 |
| 1,2,3,4-Tetrahydro-2-naphthol | 530-91-6 | 2A-9080938 |
| 4-Chloro-2-fluoro-6-iodoaniline | 216393-67-8 | 2A-9080939 |
| 2-Chloro-6-fluorophenethylamine | 149488-93-7 | 2A-9080940 |
| 1-(Piperidin-1-ylmethyl)-2-naphthol | 5342-95-0 | 2A-9080941 |
| 4-Methoxy-2-phenylazo-1-naphthol | 59900-33-3 | 2A-9080943 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA