
CAS Number52222-87-4
Synonyms6-hydroxy-2-benzoylnaphthalene; 6-Benzoyl-2-naphthol; Naphthalene,2-hydroxy-6-benzoyl; EINECS 257-755-6; MFCD00004107; 6-Hydroxy-2-naphthyl phenyl ketone; Ketone,6-hydroxy-2-naphthyl phenyl
Molecular FormulaC17H12O2
Molecular Weight248.27600
Density1.24g/cm3
Boiling Point453.8ºC at 760mmHg
Melting Point161-162ºC(lit.)
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 52222-87-4 |
| Catalog No. | 2A-9080929 |
| Chinese Name | 6-苯甲酰基-2-萘酚 |
| Synonyms | 6-hydroxy-2-benzoylnaphthalene; 6-Benzoyl-2-naphthol; Naphthalene,2-hydroxy-6-benzoyl; EINECS 257-755-6; MFCD00004107; 6-Hydroxy-2-naphthyl phenyl ketone; Ketone,6-hydroxy-2-naphthyl phenyl |
| Molecular Formula | C17H12O2 |
| Molecular Weight | 248.27600 |
| Density | 1.24g/cm3 |
| Boiling Point | 453.8ºC at 760mmHg |
| Melting Point | 161-162ºC(lit.) |
| Storage Condition | This product should be sealed and stored away from |
| HTC | 2914501900 |
| SMILES | O=C(c1ccccc1)c1ccc2cc(O)ccc2c1 |
| InChI | InChI=1S/C17H12O2/c18-16-9-8-13-10-15(7-6-14(13)11-16)17(19)12-4-2-1-3-5-12/h1-11,18H |
| InChI Key | MJKZGSBXCWNUHV-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | none |
| Transport Info | Product name: Summary 2914501900 other ketone-phenols. Supervision conditions:None. VAT: 17.0%. Tax rebate rate:9.0%. MFN tariff:5.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Ethyl3,5-dihydroxybenzoate | 4142-98-7 | 2A-9080919 |
| 4-Methyltetrahydro-2H-pyran-4-amine | 693245-65-7 | 2A-9080921 |
| 7-Methoxy-2-naphthol | 5060-82-2 | 2A-9080922 |
| 1-Bromo-propene | 590-13-6 | 2A-9080926 |
| 5-Bromo-1H-indol-3-amine | 69343-99-3 | 2A-9080928 |
| Ethyl-alpha-cyano-4-hydroxycinnamate | 6935-44-0 | 2A-9080930 |
| 4-(4-Nitrophenylazo)-1-naphthol | 5290-62-0 | 2A-9080935 |
| 3-Chloro-2,6-difluorobenzylamine | 261762-46-3 | 2A-9080937 |
| 1,2,3,4-Tetrahydro-2-naphthol | 530-91-6 | 2A-9080938 |
| 4-Chloro-2-fluoro-6-iodoaniline | 216393-67-8 | 2A-9080939 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA