
CAS Number5748-41-4
Synonyms4'-Chloro-4-biphenylcarboxylic acid; 4-(4-chlorophenyl)benzoic acid; 4'-chlorobiphenyl-4-carboxylic acid; MFCD03424592
Molecular FormulaC13H9ClO2
Molecular Weight232.662
Density1.3±0.1 g/cm3
Boiling Point398.5±25.0 °C at 760 mmHg
Melting Point293-296ºC
AppearanceWhite to yellow powder or crystal
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 5748-41-4 |
| Catalog No. | 2A-9080710 |
| Chinese Name | 4'-氯-[1,1'-联苯]-4-羧酸 |
| Synonyms | 4'-Chloro-4-biphenylcarboxylic acid; 4-(4-chlorophenyl)benzoic acid; 4'-chlorobiphenyl-4-carboxylic acid; MFCD03424592 |
| Molecular Formula | C13H9ClO2 |
| Molecular Weight | 232.662 |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 398.5±25.0 °C at 760 mmHg |
| Melting Point | 293-296ºC |
| Appearance | White to yellow powder or crystal |
| Storage Condition | room temperature |
| HTC | 2916399090 |
| SMILES | O=C(O)c1ccc(-c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C13H9ClO2/c14-12-7-5-10(6-8-12)9-1-3-11(4-2-9)13(15)16/h1-8H,(H,15,16) |
| InChI Key | FIMRRWLTRBEAOM-UHFFFAOYSA-N |
| MSDS | msds/80710_1_5748_41_4.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2-(2-Bromoacetyl)benzonitrile | 683274-86-4 | 2A-9080698 |
| 3-Amino-5-bromopicolinonitrile | 573675-27-1 | 2A-9080702 |
| 4-Chloro-N,6-diMethylpyrimidin-2-amine | 5738-15-8 | 2A-9080705 |
| 4-Hydroxyphenylaceticacidethylester | 171-38-2 | 2A-9080706 |
| 2-Methyl-2-propyl-1-pentanol | 57409-52-6 | 2A-9080709 |
| 4-Methoxy-2-nitrobenzylbromide | 57559-52-1 | 2A-9080714 |
| 6-Bromo-3-methylquinazolin-4(3H)-one | 57573-59-8 | 2A-9080716 |
| 1,14-Dibromo-3,6,9,12-tetraoxatetradecane | 57602-02-5 | 2A-9080717 |
| 7-Bromo-3,4-dihydronaphthalen-1(2H)-one | 57744-68-0 | 2A-9080724 |
| 4'-Bromo-4-cyano-biphenyl | 57774-35-3 | 2A-9080726 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA