
CAS Number25045-36-7
Synonyms2-Methoxy-5-methyl-benzoesaeure; 2-Methoxy-5-methylbenxoic acid; 6-Methoxy-m-tolylsaeure; Methylaether-p-kresotinsaeure; MFCD00045849; 2-Methoxy-5-methyl-benzoic acid
Molecular FormulaCH3OC6H3(SO2NH2)CO2CH3
Molecular Weight245.25
Purity98%
Density1.168 g/cm3
Boiling Point295.5ºC at 760 mmHg
Melting Point175-177 °C (lit.)
AppearanceWhite to off-white powder or crystal
EINECS251-358-1
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 25045-36-7 |
| Catalog No. | 2A-9080671 |
| Chinese Name | 2-甲氧基-5-甲基苯甲酸 |
| Synonyms | 2-Methoxy-5-methyl-benzoesaeure; 2-Methoxy-5-methylbenxoic acid; 6-Methoxy-m-tolylsaeure; Methylaether-p-kresotinsaeure; MFCD00045849; 2-Methoxy-5-methyl-benzoic acid |
| Molecular Formula | CH3OC6H3(SO2NH2)CO2CH3 |
| Molecular Weight | 245.25 |
| Purity | 98 |
| Density | 1.168 g/cm3 |
| Boiling Point | 295.5ºC at 760 mmHg |
| Melting Point | 175-177 °C (lit.) |
| Appearance | White to off-white powder or crystal |
| Storage Condition | Closed, cool, ventilated and dry place |
| EINECS | 251-358-1 |
| HTC | 2918990090 |
| PubChem ID | 24874260 |
| MDL Number | MFCD01317542 |
| SMILES | COC(=O)c1cc(ccc1OC)S(N)(=O)=O |
| InChI | 1S/C9H11NO5S/c1-14-8-4-3-6(16(10,12)13)5-7(8)9(11)15-2/h3-5H,1-2H3,(H2,10,12,13) |
| InChI Key | MKDYDRQLKPGNNU-UHFFFAOYSA-N |
| NACRES Code | NA.22 |
| UNSPSC | 12352100 |
| MSDS | msds/80671_1_25045_36_7.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 3,4-Dichlorobenzonitrile | 5674-99-8 | 2A-9080630 |
| 2-Cyanobenzenesulfonamide | 73542-86-6 | 2A-9080633 |
| 4,4'-Dimethylbenzhydrol | 885-77-8 | 2A-9080636 |
| 5,7-Dimethyl-3-formylchromone | 62484-76-8 | 2A-9080644 |
| 2-(2-Formyl-6-Methoxyphenoxy)AceticAcid | 40359-30-6 | 2A-9080669 |
| 3-Chloro-5-hydroxybenzotrifluoride | 570391-18-3 | 2A-9080672 |
| 5-Bromo-2-chloro-N,N-DiMethylpyrimidin-4-amine | 57054-86-1 | 2A-9080673 |
| 4-n-Tetradecyloxybenzoicacid | 15872-46-5 | 2A-9080678 |
| 5-Ethylthiazol-2-amine | 39136-60-2 | 2A-9080679 |
| 1-(3-Hydroxyphenyl)-2-methylaminoethanonehydrochloride | 94240-17-2 | 2A-9080681 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA