
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 885-77-8 |
| Catalog No. | 2A-9080636 |
| Chinese Name | 4,4'-二甲基二苯基甲醇 |
| Synonyms | bis(4-methylphenyl)methanol; MFCD00017216 |
| Molecular Formula | C15H16O |
| Molecular Weight | 212.28700 |
| Density | 1.063g/cm3 |
| Boiling Point | 352.7ºC at 760 mmHg |
| Melting Point | 71-73°C |
| Appearance | Solid;White to Almost white powder to crystal |
| Water Solubility | Water solubility: insoluble; soluble in: methanol |
| Storage Condition | Keep container sealed and store in a cool, dry pla |
| HTC | 2902909090 |
| SMILES | Cc1ccc(C(O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C15H16O/c1-11-3-7-13(8-4-11)15(16)14-9-5-12(2)6-10-14/h3-10,15-16H,1-2H3 |
| InChI Key | RGYZQSCFKFDECZ-UHFFFAOYSA-N |
| MSDS | msds/80636_1_885_77_8.pdf |
| Tax Rebate | 9.0% |
| Supervision | None. MFN tariff: 2.0%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2902909090 other aromatic hydrocarbons. Supervision conditions:None. VAT: 17.0%. Tax rebate rate:9.0%. MFN tariff: 2.0%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 4-Bromo-O-phenylenediamine | 1575-97-7 | 2A-9080627 |
| 3-Amino-1-(2-Aminophenyl)-propan-1-one | 363-36-0 | 2A-9080628 |
| 6-amino-3,4-dihydro-2(1)-quinalinone | 22246-13-5 | 2A-9080629 |
| 3,4-Dichlorobenzonitrile | 5674-99-8 | 2A-9080630 |
| 2-Cyanobenzenesulfonamide | 73542-86-6 | 2A-9080633 |
| 5,7-Dimethyl-3-formylchromone | 62484-76-8 | 2A-9080644 |
| 2-(2-Formyl-6-Methoxyphenoxy)AceticAcid | 40359-30-6 | 2A-9080669 |
| 5-Methoxy-2-methylbenzoicacid | 25045-36-7 | 2A-9080671 |
| 3-Chloro-5-hydroxybenzotrifluoride | 570391-18-3 | 2A-9080672 |
| 5-Bromo-2-chloro-N,N-DiMethylpyrimidin-4-amine | 57054-86-1 | 2A-9080673 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA