
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 400745-60-0 |
| Catalog No. | 2A-9080640 |
| Chinese Name | 2'-氟二苯-2-甲醛 |
| Synonyms | 3'-chloro[1,1'-biphenyl]-3-carbaldehyde; OR7348 |
| Molecular Formula | C13H9ClO |
| Molecular Weight | 216.66 |
| Density | 1.214g/cm3 |
| Boiling Point | 362.5ºC at 760mmHg |
| Appearance | solid |
| HTC | 2913000090 |
| PubChem ID | 329819719 |
| MDL Number | MFCD11933385 |
| SMILES | O=CC1=CC=C(Cl)C(C2=CC=CC=C2)=C1 |
| InChI | 1S/C13H9ClO/c14-13-7-6-10(9-15)8-12(13)11-4-2-1-3-5-11/h1-9H |
| InChI Key | ZASCVQZHZZGACQ-UHFFFAOYSA-N |
| NACRES Code | NA.21 |
| UNSPSC | 12352200 |
| MSDS | msds/80640_1_400745_60_0.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2913000090 halogenated, sulphonated, nitrated or nitrosated derivatives of products of heading 2912 Educational tariff:17.0% Tax rebate rate:9.0% Regulatory conditions:none Most favored nation tariff:5.5% General tariff:30.0% |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| 10-Chloro-9-anthraldehyde | 10527-16-9 | 2A-9080634 |
| 2-Hydroxy-3-ethoxybenzaldehyde | 492-88-6 | 2A-9080635 |
| 2',4'-Dimethoxybiphenyl-3-carbaldehyde | 728919-18-4 | 2A-9080637 |
| 2-(2-Chlorobenzyloxy)benzaldehyde | 53389-99-4 | 2A-9080638 |
| 2-(3-Chlorobenzyloxy)benzaldehyde | 40359-59-9 | 2A-9080639 |
| 4'-Chlorobiphenyl-3-carbaldehyde | 139502-80-0 | 2A-9080641 |
| 3',4'-Dimethylbiphenyl-3-carbaldehyde | 343604-07-9 | 2A-9080642 |
| 3',4'-Dimethylbiphenyl-4-carbaldehyde | 343604-05-7 | 2A-9080643 |
| 4-Methyl-1-naphthaldehyde | 33738-48-6 | 2A-9080645 |
| 3-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)benzaldehyde | 380151-86-0 | 2A-9080646 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA