
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 10527-16-9 |
| Catalog No. | 2A-9080634 |
| Chinese Name | 10-氯蒽-9-甲醛 |
| Synonyms | EINECS 234-086-8; 10-chloroanthracene-9-carbaldehyde; MFCD00001255 |
| Molecular Formula | C15H8ClN |
| Molecular Weight | 237.691 |
| Density | 1.327g/cm3 |
| Boiling Point | 435.9ºC at 760mmHg |
| Melting Point | 215-218ºC(lit.) |
| Storage Condition | Store in an airtight, cool and dry place, ensuring |
| HTC | 2913000090 |
| MDL Number | MFCD00723083 |
| SMILES | O=Cc1c2ccccc2c(Cl)c2ccccc12 |
| InChI | InChI=1S/C15H9ClO/c16-15-12-7-3-1-5-10(12)14(9-17)11-6-2-4-8-13(11)15/h1-9H |
| InChI Key | SHYBXXMECBHHFH-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2913000090 halogenated, sulphonated, nitrated or nitrosated derivatives of products of heading 2912 Educational tariff:17.0% Tax rebate rate:9.0% Regulatory conditions:none Most favored nation tariff:5.5% General tariff:30.0% |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| 4-(Diphenylamino)benzaldehydediphenylhydrazone | 82532-76-1 | 2A-9080581 |
| 4-Dimethylamino-2-methoxybenzaldehyde | 84562-48-1 | 2A-9080582 |
| 4-(Dibenzylamino)benzaldehyde-N,N-diphenylhydrazone | 85171-94-4 | 2A-9080583 |
| (3-Amino-5-nitrophenyl)boronicacid | 89466-05-7 | 2A-9080593 |
| 4-(Bromomethyl)benzonitrile | 17201-43-4 | 2A-9080631 |
| 2-Hydroxy-3-ethoxybenzaldehyde | 492-88-6 | 2A-9080635 |
| 2',4'-Dimethoxybiphenyl-3-carbaldehyde | 728919-18-4 | 2A-9080637 |
| 2-(2-Chlorobenzyloxy)benzaldehyde | 53389-99-4 | 2A-9080638 |
| 2-(3-Chlorobenzyloxy)benzaldehyde | 40359-59-9 | 2A-9080639 |
| 3'-Chlorobiphenyl-3-carbaldehyde | 400745-60-0 | 2A-9080640 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA