
CAS Number93-45-8
Synonyms4-(2-Naphthylamino)phenol; N-(p-Hydroxyphenyl)-2-naphthylamine; 4-(naphthalen-2-ylamino)phenol; N-(4-Hydroxyphenyl)-2-naphthylamine
Molecular FormulaC16H13NO
Molecular Weight235.281
Density1.3±0.1 g/cm3
Boiling Point424.4±20.0 °C at 760 mmHg
Melting Point139-142ºC(lit.)
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 93-45-8 |
| Catalog No. | 2A-9080550 |
| Chinese Name | N-(对羟基苯基)-2-萘胺 |
| Synonyms | 4-(2-Naphthylamino)phenol; N-(p-Hydroxyphenyl)-2-naphthylamine; 4-(naphthalen-2-ylamino)phenol; N-(4-Hydroxyphenyl)-2-naphthylamine |
| Molecular Formula | C16H13NO |
| Molecular Weight | 235.281 |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 424.4±20.0 °C at 760 mmHg |
| Melting Point | 139-142ºC(lit.) |
| Storage Condition | room temperature, dry |
| HTC | 2922299090 |
| SMILES | Oc1ccc(Nc2ccc3ccccc3c2)cc1 |
| InChI | InChI=1S/C16H13NO/c18-16-9-7-14(8-10-16)17-15-6-5-12-3-1-2-4-13(12)11-15/h1-11,17-18H |
| InChI Key | RACMGQBQYYWANW-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 4-(Diethylamino)benzophenone | 18127-87-2 | 2A-9080543 |
| N-(4-Aminophenyl)methanesulfonamidehydrochloride | 57005-04-6 | 2A-9080545 |
| 1-Naphthaleneacethdrzide | 34800-90-3 | 2A-9080546 |
| 4,4'-Bis(methylamino)benzophenone | 3708-39-2 | 2A-9080547 |
| 6-Dimethylamino-4-hydroxy-2-naphthalenesulfonicacid | 6259-50-3 | 2A-9080549 |
| o-(P-Nitrobenzyl)-N,N'-diisopropylurea | 2978-11-2 | 2A-9080551 |
| N-Ethyl-2-nitroaniline | 10112-15-9 | 2A-9080552 |
| N-Methyl-4-nitro-o-toluidine | 10439-77-7 | 2A-9080553 |
| S-(4,5-Dimethoxy-2-nitrobenzyl)isothiouroniumbromide | 155614-05-4 | 2A-9080555 |
| 2-[2-[4-(4-Nitrobenzyloxy)phenyl]ethyl]isothioureamesylate | 182004-65-5 | 2A-9080556 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA