
CAS Number34800-90-3
Synonyms1-NAPHTHYLACETIC HYDRAZIDE; MFCD00014318; 1-NAPHTHALENEACETHYDRAZIDE; 2-(Naphthalen-1-yl)acetohydrazide; 2-naphthylacetohydrazide; 1-naphthylacetic acid hydrazide
Molecular FormulaC12H12N2O
Molecular Weight200.242
Density1.206 g/cm3
Boiling Point466.4ºC at 760 mmHg
Melting Point168-169°C
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 34800-90-3 |
| Catalog No. | 2A-9080546 |
| Chinese Name | 1-萘乙酰肼 |
| Synonyms | 1-NAPHTHYLACETIC HYDRAZIDE; MFCD00014318; 1-NAPHTHALENEACETHYDRAZIDE; 2-(Naphthalen-1-yl)acetohydrazide; 2-naphthylacetohydrazide; 1-naphthylacetic acid hydrazide |
| Molecular Formula | C12H12N2O |
| Molecular Weight | 200.242 |
| Density | 1.206 g/cm3 |
| Boiling Point | 466.4ºC at 760 mmHg |
| Melting Point | 168-169°C |
| Storage Condition | Keep the container sealed and stored in a cool, dr |
| HTC | 2928000090 |
| MDL Number | MFCD00014318 |
| SMILES | NNC(=O)Cc1cccc2ccccc12 |
| InChI | InChI=1S/C12H12N2O/c13-14-12(15)8-10-6-3-5-9-4-1-2-7-11(9)10/h1-7H,8,13H2,(H,14,15) |
| InChI Key | FLHXVKZDKJAVMB-UHFFFAOYSA-N |
| MSDS | msds/80546_1_34800_90_3.pdf |
| Tax Rebate | 9.0% |
| Supervision | none |
| Transport Info | Product name: Summary 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 1-(3-Methylphenyl)-2-thiourea | 621-40-9 | 2A-9080540 |
| 2-(2-Chlorophenoxy)aniline | 56966-47-3 | 2A-9080541 |
| 2,2'-Dithio-bis[N,N-dimethyl]ethaneaminedihydrochloride | 17339-60-5 | 2A-9080542 |
| 4-(Diethylamino)benzophenone | 18127-87-2 | 2A-9080543 |
| N-(4-Aminophenyl)methanesulfonamidehydrochloride | 57005-04-6 | 2A-9080545 |
| 4,4'-Bis(methylamino)benzophenone | 3708-39-2 | 2A-9080547 |
| 6-Dimethylamino-4-hydroxy-2-naphthalenesulfonicacid | 6259-50-3 | 2A-9080549 |
| 2-(4'-Hydroxyphenylamino)-naphthalene | 93-45-8 | 2A-9080550 |
| o-(P-Nitrobenzyl)-N,N'-diisopropylurea | 2978-11-2 | 2A-9080551 |
| N-Ethyl-2-nitroaniline | 10112-15-9 | 2A-9080552 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA