
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 5691-09-8 |
| Catalog No. | 2A-9080529 |
| Chinese Name | 反式-2-氨甲基-1-环己醇 |
| Synonyms | MFCD00145420; trans-2-aminomethyl-1-cyclohexanol |
| Molecular Formula | C9H18O |
| Molecular Weight | 142.243 |
| Boiling Point | 226.4ºC at 760mmHg |
| Appearance | Liquid After Melting | Clear colorless |
| Storage Condition | Store airtight in a cool, dry warehouse. Keep away |
| HTC | 2922199090 |
| MDL Number | MFCD00019331 |
| SMILES | [NH3+]C[C@@H]1CCCC[C@H]1O |
| InChI | InChI=1S/C7H15NO/c8-5-6-3-1-2-4-7(6)9/h6-7,9H,1-5,8H2/p+1/t6-,7+/m0/s1 |
| InChI Key | InChIKey=JGKFBZBVCAWDFD-NKWVEPMBSA-O |
| MSDS | msds/80529_1_5691_09_8.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2922199090. other amino-alcohols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 3-Isopropylbenzoicacid | 5651-47-8 | 2A-9080498 |
| 2-Hydroxy-3,4-dimethoxy-benzoicacid | 5653-46-3 | 2A-9080501 |
| 2-(Cyclohexylamino)aceticacidhydrochloride | 56676-70-1 | 2A-9080519 |
| EthylL-isoleucinatehydrochloride | 56782-52-6 | 2A-9080521 |
| 2-Chloro-2-[2-(4-chlorophenyl)hydrazono]-N-phenylacetamide | 33101-97-2 | 2A-9080527 |
| 4-(4-Methylphenoxy)phenylhydrazinehydrochloride | 108902-83-6 | 2A-9080531 |
| N-Methyl-N-phenylthiocarbamoylchloride | 19009-45-1 | 2A-9080535 |
| 1,8-Naphthalenediol | 569-42-6 | 2A-9080538 |
| 2-Bromo-3-chlorobenzoicacid | 56961-26-3 | 2A-9080539 |
| 1-(3-Methylphenyl)-2-thiourea | 621-40-9 | 2A-9080540 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA