
CAS Number5653-46-3
Synonyms3,4-Dimethoxysalicylic acid; 3.4-Dimethoxy-salicylsaeure; 2-hydroxy-3,4-dimethoxy-benzoic acid; 2-Hydroxy-3,4-dimethoxy-benzoesaeure; 3,4-dimethoxy-2-hydroxybenzoic acid; 2-hydroxy-3,4-dimethoxybenzoes; 2-Oxy-3.4-dimethoxy-benzoesaeure
Molecular FormulaC9H10O5
Molecular Weight198.17300
Density1.335g/cm3
Boiling Point334.2ºC at 760mmHg
Melting Point170-172ºC
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 5653-46-3 |
| Catalog No. | 2A-9080501 |
| Chinese Name | 2-羟基-3,4-二甲氧基苯甲酸 |
| Synonyms | 3,4-Dimethoxysalicylic acid; 3.4-Dimethoxy-salicylsaeure; 2-hydroxy-3,4-dimethoxy-benzoic acid; 2-Hydroxy-3,4-dimethoxy-benzoesaeure; 3,4-dimethoxy-2-hydroxybenzoic acid; 2-hydroxy-3,4-dimethoxybenzoes; 2-Oxy-3.4-dimethoxy-benzoesaeure |
| Molecular Formula | C9H10O5 |
| Molecular Weight | 198.17300 |
| Density | 1.335g/cm3 |
| Boiling Point | 334.2ºC at 760mmHg |
| Melting Point | 170-172ºC |
| Storage Condition | Room temperature, store in inert gas |
| HTC | 2918990090 |
| SMILES | COc1ccc(C(=O)O)c(O)c1OC |
| InChI | InChI=1S/C9H10O5/c1-13-6-4-3-5(9(11)12)7(10)8(6)14-2/h3-4,10H,1-2H3,(H,11,12) |
| InChI Key | CJFQIVAOBBTJCI-UHFFFAOYSA-N |
| MSDS | msds/80501_1_5653_46_3.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Z-Ser-Obzl | 21209-51-8 | 2A-9080488 |
| Z-Tyr(Bzl)-OH | 16677-29-5 | 2A-9080489 |
| Cyclopropanemethylaminehydrochloride | 7252-53-1 | 2A-9080491 |
| 4-Cyclopropyl-6-(methylthio)-1,3,5-triazin-2-amine | 175204-57-6 | 2A-9080492 |
| 3-Isopropylbenzoicacid | 5651-47-8 | 2A-9080498 |
| 2-(Cyclohexylamino)aceticacidhydrochloride | 56676-70-1 | 2A-9080519 |
| EthylL-isoleucinatehydrochloride | 56782-52-6 | 2A-9080521 |
| 2-Chloro-2-[2-(4-chlorophenyl)hydrazono]-N-phenylacetamide | 33101-97-2 | 2A-9080527 |
| Trans-2-aminomethyl-1-cyclohexanol | 5691-09-8 | 2A-9080529 |
| 4-(4-Methylphenoxy)phenylhydrazinehydrochloride | 108902-83-6 | 2A-9080531 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA