
CAS Number38233-47-5
Synonyms5-Methoxy-2,3,4-trifluorobenzoic acid; 2,3,4-Trifluoro-5-methoxybenzoic acid; 2,3,4,5,6-PENTAFLUOROBENZYL CHLORIDE; 2,3,4-Trifluor-5-methoxybenzoesaeure; 2,3,4-trifluoro-5-methoxy benzoic acid
Molecular FormulaC8H5F3O3
Molecular Weight206.12
Density1.5±0.1 g/cm3
Boiling Point293.1±35.0 °C at 760 mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 38233-47-5 |
| Catalog No. | 2A-9079751 |
| Chinese Name | 2,3,4-三氟-5-甲氧基苯甲酸 |
| Synonyms | 5-Methoxy-2,3,4-trifluorobenzoic acid; 2,3,4-Trifluoro-5-methoxybenzoic acid; 2,3,4,5,6-PENTAFLUOROBENZYL CHLORIDE; 2,3,4-Trifluor-5-methoxybenzoesaeure; 2,3,4-trifluoro-5-methoxy benzoic acid |
| Molecular Formula | C8H5F3O3 |
| Molecular Weight | 206.12 |
| Density | 1.5±0.1 g/cm3 |
| Boiling Point | 293.1±35.0 °C at 760 mmHg |
| Storage Condition | 2-8°C, dry, sealed |
| HTC | 2918990090 |
| PubChem ID | 37489640 |
| SMILES | COc1cc(C(=O)O)c(F)c(F)c1F |
| InChI | InChI=1S/C8H5F3O3/c1-14-4-2-3(8(12)13)5(9)7(11)6(4)10/h2H,1H3,(H,12,13) |
| InChI Key | CGMSFYATZQKRJY-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2-Hydroxynaphthalene-1-carbonylchloride | 38077-75-7 | 2A-9079741 |
| Methyl5-bromo-6-hydroxynicotinate | 381247-99-0 | 2A-9079743 |
| 2-Aminocycloheptanecarboxylicacid | 3814-46-8 | 2A-9079744 |
| 2-Amino-4-hydroxybenzoicacid | 38160-63-3 | 2A-9079748 |
| N-Butyl-N-(4-hydroxybutyl)nitrousamide | 3817-11-6 | 2A-9079749 |
| 4-Androsten-11Beta-ol-3,17-dione | 382-44-5 | 2A-9079754 |
| 2-Chloro-1,3-difluoro-5-nitro-benzene | 3828-41-9 | 2A-9079755 |
| 2-(Benzyloxy)-1-ethanamine | 38336-04-8 | 2A-0202022 |
| 2,3-Dibromohexafluoro-2-butene | 384-51-0 | 2A-9079761 |
| 2-Amino-4-methoxybenzonitrile | 38487-85-3 | 2A-9079763 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA