
CAS Number5399-68-8
SynonymsBenzaldehyde,2,4-dihydroxy-,oxime; (E)-2,4-Dihydroxybenzaldehyde oxime; 2,4-Dihydroxy-benzaldehyd-oxim; 2.4-Dihydroxy-benzaldoxim; 2.4-Dioxy-benzaldoxim; 2,4-dihydroxy-benzaldehyde oxime; Resorcylaldoxim; 2,4-dihydroxy-benzaldehydoxime; 2,4-Dihydroxybenzaldoxime
Molecular FormulaC7H7NO3
Molecular Weight153.13500
Density1.319g/cm3
Boiling Point578.5ºC at 760mmHg
Appearancewhite solid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 5399-68-8 |
| Catalog No. | 2A-9079721 |
| Chinese Name | 2,4-二羟基苯甲醛肟 |
| Synonyms | Benzaldehyde,2,4-dihydroxy-,oxime; (E)-2,4-Dihydroxybenzaldehyde oxime; 2,4-Dihydroxy-benzaldehyd-oxim; 2.4-Dihydroxy-benzaldoxim; 2.4-Dioxy-benzaldoxim; 2,4-dihydroxy-benzaldehyde oxime; Resorcylaldoxim; 2,4-dihydroxy-benzaldehydoxime; 2,4-Dihydroxybenzaldoxime |
| Molecular Formula | C7H7NO3 |
| Molecular Weight | 153.13500 |
| Density | 1.319g/cm3 |
| Boiling Point | 578.5ºC at 760mmHg |
| Appearance | white solid |
| Storage Condition | Room temperature, sealed, dry |
| HTC | 2928000090 |
| PubChem ID | 71071 |
| SMILES | ON=Cc1ccc(O)cc1O |
| InChI | InChI=1S/C7H7NO3/c9-6-2-1-5(4-8-11)7(10)3-6/h1-4,8,10-11H/b5-4- |
| InChI Key | YIAZXUFZAYNWTP-XBXARRHUSA-N |
| Tax Rebate | 9.0% |
| Supervision | none |
| Transport Info | Product name: Summary 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| Related Products in Agrochemical Intermediates | ||
|---|---|---|
| 2,4-Difluoro-5-methylbenzoicacid | 367954-99-2 | 2A-9079292 |
| 6-Bromomethyl-pteridine-2,4-diamineHBr | 52853-40-4 | 2A-9079357 |
| Ethyl2,4-diMethylpyridine-3-carboxylate | 37669-78-6 | 2A-9079374 |
| 2,4,5-Triamino-6-hydroxypyrimidine | 51324-37-9 | 2A-9079626 |
| Ethyl2,4-dichloronicotinate | 62022-04-2 | 2A-9079670 |
| 2,4-Dichlorobenzoylacetonitrile | 39528-61-5 | 2A-9079801 |
| Ethyl2,4-dichloro-6-MethylNicotinate | 86129-63-7 | 2A-9079813 |
| 2,4-Dimethyl-3-pyrrolepropionicacid | 54474-50-9 | 2A-9079928 |
| 5,5-Diethyl-imidazolidine-2,4-dione | 5455-34-5 | 2A-9079943 |
| 4-[(2,4-Dichloro-5-methoxyphenyl)amino]-7-fluoro-6-methoxy-3-quinolinecarbonitrile | 622369-46-4 | 2A-9079955 |
| Browse all Agrochemical Intermediates products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA