
CAS Number37669-78-6
Synonyms3-Pyridinecarboxylic acid, 2,4-dimethyl-, ethyl ester; Ethyl 2,4-dimethylnicotinate; MFCD00051962; ETHYL 2,4-DIMETHYLPYRIDINE-3-CARBOXYLATE; Ethyl-2,4-dimethylpyridine-3-carboxylate
Molecular FormulaC10H13NO2
Molecular Weight179.22
Density1.1±0.1 g/cm3
Boiling Point237.5±35.0 °C at 760 mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 37669-78-6 |
| Catalog No. | 2A-9079374 |
| Chinese Name | 乙基2,4-二甲基吡啶-3-羧化物 |
| Synonyms | 3-Pyridinecarboxylic acid, 2,4-dimethyl-, ethyl ester; Ethyl 2,4-dimethylnicotinate; MFCD00051962; ETHYL 2,4-DIMETHYLPYRIDINE-3-CARBOXYLATE; Ethyl-2,4-dimethylpyridine-3-carboxylate |
| Molecular Formula | C10H13NO2 |
| Molecular Weight | 179.22 |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 237.5±35.0 °C at 760 mmHg |
| Storage Condition | Sealed, cool and dry storage |
| HTC | 2933399090 |
| PubChem ID | 5644307 |
| SMILES | CCOC(=O)c1c(C)ccnc1C |
| InChI | InChI=1S/C10H13NO2/c1-4-13-10(12)9-7(2)5-6-11-8(9)3/h5-6H,4H2,1-3H3 |
| InChI Key | DIZHKKYVLBSXAW-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Related Products in Agrochemical Intermediates | ||
|---|---|---|
| 2,4-Dimethyl-3-fluorobenzaldehyde | 363134-36-5 | 2A-9079247 |
| Potassium(2,4-diMethylphenyl)trifluoroborate | 850245-50-0 | 2A-9079253 |
| 2,4-Dichloro-6-methoxy-1,3,5-triazine | 3638-04-8 | 2A-9079257 |
| 2,4-Difluoro-5-methylbenzoicacid | 367954-99-2 | 2A-9079292 |
| 6-Bromomethyl-pteridine-2,4-diamineHBr | 52853-40-4 | 2A-9079357 |
| 2,4,5-Triamino-6-hydroxypyrimidine | 51324-37-9 | 2A-9079626 |
| Ethyl2,4-dichloronicotinate | 62022-04-2 | 2A-9079670 |
| (E)-2,4-Dihydroxybenzaldehydeoxime | 5399-68-8 | 2A-9079721 |
| 2,4-Dichlorobenzoylacetonitrile | 39528-61-5 | 2A-9079801 |
| Ethyl2,4-dichloro-6-MethylNicotinate | 86129-63-7 | 2A-9079813 |
| Browse all Agrochemical Intermediates products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA