CAS Number51012-65-8
Synonyms2-Bromo-1-o-tolyl-ethanone; bromomethyl 2-methylphenyl ketone; 1-bromo-2-(2-methylphenyl)-2-oxoethane; 2-Bromo-1-(2-methylphenyl)ethanone; 2-bromo-1-(2-methylphenyl)ethan-1-one; 2-Bromo-1-(o-Tolyl)ethanone; 2-bromo-1-(2-methylphenyl)-1-ethanone; 2-(Bromoacetyl)toluene; 2-Methylphenacyl Bromide
Molecular FormulaC9H9BrO
Molecular Weight213.071
Density1.4±0.1 g/cm3
Boiling Point257.3±15.0 °C at 760 mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 51012-65-8 |
| Catalog No. | 2A-9079607 |
| Chinese Name | 2-溴-1-O-甲苯基-乙酮 |
| Synonyms | 2-Bromo-1-o-tolyl-ethanone; bromomethyl 2-methylphenyl ketone; 1-bromo-2-(2-methylphenyl)-2-oxoethane; 2-Bromo-1-(2-methylphenyl)ethanone; 2-bromo-1-(2-methylphenyl)ethan-1-one; 2-Bromo-1-(o-Tolyl)ethanone; 2-bromo-1-(2-methylphenyl)-1-ethanone; 2-(Bromoacetyl)toluene; 2-Methylphenacyl Bromide |
| Molecular Formula | C9H9BrO |
| Molecular Weight | 213.071 |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 257.3±15.0 °C at 760 mmHg |
| Storage Condition | 2-8°C |
| HTC | 2914700090 |
| PubChem ID | 28674667 |
| SMILES | Cc1ccccc1C(=O)CBr |
| InChI | InChI=1S/C9H9BrO/c1-7-4-2-3-5-8(7)9(11)6-10/h2-5H,6H2,1H3 |
| InChI Key | XMGAXELQRATLJP-UHFFFAOYSA-N |
| MSDS | msds/79607_1_51012_65_8.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| [7-(9H-Fluoren-9-ylmethoxycarbonylamino)-2-oxo-2H-chromen-4-yl]-aceticacid | 378247-75-7 | 2A-9079597 |
| 3,6-Dihydroxyphthalicacid | 3786-46-7 | 2A-9079598 |
| 1-(Pyridazin-4-yl)ethanone | 50901-46-7 | 2A-9079602 |
| 4-Bromo-2-(trifluoromethoxy)benzoicacid | 509142-48-7 | 2A-9079603 |
| 5-Amino-2,3-dichlorobenzoicacid | 50917-32-3 | 2A-9079604 |
| 8-Methyl-1-tetralone | 51015-28-2 | 2A-9079608 |
| 1-Methyl-2-pyridin-2-yl-Ethylamine | 51038-40-5 | 2A-9079609 |
| 6-Methoxy-1H-indazol-3-amine | 511225-17-5 | 2A-9079614 |
| 4-Amino-2,3-dihydroinden-1-one | 51135-91-2 | 2A-9079616 |
| (4-Benzyloxy-phenyl)-hydrazine | 51145-58-5 | 2A-9079617 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS