
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 3786-46-7 |
| Catalog No. | 2A-9079598 |
| Chinese Name | 3,6-二羟基邻苯二甲酸 |
| Synonyms | 3,6-dihydroxyphthalic acid |
| Molecular Formula | C8H6O6 |
| Molecular Weight | 198.13 |
| Density | 1.779g/cm3 |
| Boiling Point | 483.7ºC at 760mmHg |
| Storage Condition | Store at room temperature, away from light, in a v |
| HTC | 2918290000 |
| PubChem ID | 470743 |
| MDL Number | MFCD00096284 |
| SMILES | O=C(O)c1c(O)ccc(O)c1C(=O)O |
| InChI | InChI=1S/C8H6O6/c9-3-1-2-4(10)6(8(13)14)5(3)7(11)12/h1-2,9-10H,(H,11,12)(H,13,14) |
| InChI Key | UDKMUSGWGWZJBZ-UHFFFAOYSA-N |
| MSDS | msds/79598_1_3786_46_7.pdf |
| Tax Rebate | 9.0% |
| Supervision | A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Inspection | R. Hygiene supervision and inspection of imported food S. Hygiene supervision and inspection of exported food |
| Transport Info | Product name: Supervision conditions A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 5-Chloro-2-methylbenzonitrile | 50712-70-4 | 2A-9079591 |
| 3-Hydroxy-5-iodobenzoicacid | 50765-21-4 | 2A-9079592 |
| N-Aminomaleimide | 37770-94-8 | 2A-9079594 |
| 5-Methyl-2-nitrophenylaceticacid | 37777-81-4 | 2A-9079595 |
| [7-(9H-Fluoren-9-ylmethoxycarbonylamino)-2-oxo-2H-chromen-4-yl]-aceticacid | 378247-75-7 | 2A-9079597 |
| 1-(Pyridazin-4-yl)ethanone | 50901-46-7 | 2A-9079602 |
| 4-Bromo-2-(trifluoromethoxy)benzoicacid | 509142-48-7 | 2A-9079603 |
| 5-Amino-2,3-dichlorobenzoicacid | 50917-32-3 | 2A-9079604 |
| 2-Bromo-1-O-tolyl-ethanone | 51012-65-8 | 2A-9079607 |
| 8-Methyl-1-tetralone | 51015-28-2 | 2A-9079608 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA