
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 5029-61-8 |
| Catalog No. | 2A-9079566 |
| Chinese Name | 2-溴-4-羟基-3-硝基苯乙酮 |
| Synonyms | 2-broMo-1-(4-hydroxy-3-nitrophenyl)ethan-1-one; 2-bromo-1-(4-hydroxy-3-nitrophenyl)ethanone |
| Molecular Formula | C8H6BrNO4 |
| Molecular Weight | 260.04 |
| Density | 1.8 g/cm3 |
| Boiling Point | 331.6ºC at 760mmHg |
| Appearance | solid |
| HTC | 2914700090 |
| PubChem ID | 329815540 |
| MDL Number | MFCD03424358 |
| SMILES | Oc1ccc(cc1[N+]([O-])=O)C(=O)CBr |
| InChI | 1S/C8H6BrNO4/c9-4-8(12)5-1-2-7(11)6(3-5)10(13)14/h1-3,11H,4H2 |
| InChI Key | ADFUHIYILOQDHG-UHFFFAOYSA-N |
| NACRES Code | NA.21 |
| UNSPSC | 12352200 |
| MSDS | msds/79566_1_5029_61_8.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 4-(4-Hydroxyphenoxy)benzoicacid | 500-76-5 | 2A-9079556 |
| (2-Fluoro-6-methoxyphenyl)aceticacid | 500912-16-9 | 2A-9079557 |
| 4-Chloro-3-fluoroanisole | 501-29-1 | 2A-9079561 |
| 4-Carboxyphenylaceticacid | 501-89-3 | 2A-9079562 |
| SodiumOxybate | 502-85-2 | 2A-9079564 |
| 4-Amino-3-fluorophenylaceticacid | 503315-77-3 | 2A-9079567 |
| Trimethylsulfoxoniumchloride | 5034-06-0 | 2A-9079568 |
| 1-Pyridin-3-yl-cyclopropylamine | 503417-38-7 | 2A-9079569 |
| 2-Amino-2-(2-nitrophenyl)aceticacid | 50381-53-8 | 2A-9079574 |
| 6-Fluoro-2-naphthoicacid | 5043-01-6 | 2A-9079575 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA