CAS Number502-85-2
SynonymsGHB; Sodium 4-hydroxybutanoate; Xyrem; 4-Hydroxybutyrate sodium; Butanoic acid, 4-hydroxy-, sodium salt (1:1); Sodium Oxybate; GHB SODIUM SALT; Butanoic acid, 4-hydroxy-, monosodium salt; Butanoic acid, 4-hydroxy-, sodium salt; gammaoh; MFCD00004402; γ-OH; SODIUM 4-HYDROXYBUTYRATE; γ-Hydroxybutyrate sodium; wy-3478; 4-Hydroxybutanoic Acid Monosodium Salt; 4-Hydroxybutyric acid monosodium salt; Sodium γ-hydroxybutyrate; somsanit; γ-Hydroxybutyric acid monosodium salt; Butyric acid, 4-hydroxy-, sodium salt; Butyric acid, 4-hydroxy-, monosodium salt; Sodium Oxybate [USAN]; 4-Hydroxybutyric acid sodium salt; EINECS 207-953-3
Molecular FormulaC4H8NaO3+
Molecular Weight126.086
Boiling Point295.6ºC at 760mmHg
Melting Point145-146ºC
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 502-85-2 |
| Catalog No. | 2A-9079564 |
| Chinese Name | 4-羟基丁酸钠 |
| Synonyms | GHB; Sodium 4-hydroxybutanoate; Xyrem; 4-Hydroxybutyrate sodium; Butanoic acid, 4-hydroxy-, sodium salt (1:1); Sodium Oxybate; GHB SODIUM SALT; Butanoic acid, 4-hydroxy-, monosodium salt; Butanoic acid, 4-hydroxy-, sodium salt; gammaoh; MFCD00004402; γ-OH; SODIUM 4-HYDROXYBUTYRATE; γ-Hydroxybutyrate sodium; wy-3478; 4-Hydroxybutanoic Acid Monosodium Salt; 4-Hydroxybutyric acid monosodium salt; Sodium γ-hydroxybutyrate; somsanit; γ-Hydroxybutyric acid monosodium salt; Butyric acid, 4-hydroxy-, sodium salt; Butyric acid, 4-hydroxy-, monosodium salt; Sodium Oxybate [USAN]; 4-Hydroxybutyric acid sodium salt; EINECS 207-953-3 |
| Molecular Formula | C4H8NaO3+ |
| Molecular Weight | 126.086 |
| Boiling Point | 295.6ºC at 760mmHg |
| Melting Point | 145-146ºC |
| Storage Condition | Controlled Substance, -20?C Freezer |
| HTC | 2918199090 |
| PubChem ID | 3133436 |
| SMILES | [Na+].OCCCC([O-])=O |
| InChI | InChI=1S/C4H8O3.Na/c5-3-1-2-4(6)7;/h5H,1-3H2,(H,6,7);/q;+1/p-1 |
| InChI Key | InChIKey=XYGBKMMCQDZQOZ-UHFFFAOYSA-M |
| Tax Rebate | 9.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918199090 other carboxylic acids with alcohol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives. Supervision conditions:None. VAT: 17.0%. Tax rebate rate:9.0%. MFN tariff: 6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 4-Methylphthalazin-1(2H)-one | 5004-48-8 | 2A-9079555 |
| 4-(4-Hydroxyphenoxy)benzoicacid | 500-76-5 | 2A-9079556 |
| (2-Fluoro-6-methoxyphenyl)aceticacid | 500912-16-9 | 2A-9079557 |
| 4-Chloro-3-fluoroanisole | 501-29-1 | 2A-9079561 |
| 4-Carboxyphenylaceticacid | 501-89-3 | 2A-9079562 |
| 2-Bromo-4'-hydroxy-3'-nitroacetophenone | 5029-61-8 | 2A-9079566 |
| 4-Amino-3-fluorophenylaceticacid | 503315-77-3 | 2A-9079567 |
| Trimethylsulfoxoniumchloride | 5034-06-0 | 2A-9079568 |
| 1-Pyridin-3-yl-cyclopropylamine | 503417-38-7 | 2A-9079569 |
| 2-Amino-2-(2-nitrophenyl)aceticacid | 50381-53-8 | 2A-9079574 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS