
CAS Number833-85-2
Synonyms5-(4-Methylphenyl)-5-oxovaleric acid; p-toluoylbutyric acid; 5-oxo-5-p-tolyl-valeric acid; 4-benzoylbutyric acid; 4-(4-methylbenzoyl)butyric acid; 4-p-Toluoylbutyric acid; 5-Oxo-5-p-tolyl-pentanoic acid
Molecular FormulaC12H14O3
Molecular Weight206.23800
Density1.137g/cm3
Boiling Point399.5ºC at 760 mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 833-85-2 |
| Catalog No. | 2A-9079130 |
| Chinese Name | 5-氧代-5-(对甲苯基)戊酸 |
| Synonyms | 5-(4-Methylphenyl)-5-oxovaleric acid; p-toluoylbutyric acid; 5-oxo-5-p-tolyl-valeric acid; 4-benzoylbutyric acid; 4-(4-methylbenzoyl)butyric acid; 4-p-Toluoylbutyric acid; 5-Oxo-5-p-tolyl-pentanoic acid |
| Molecular Formula | C12H14O3 |
| Molecular Weight | 206.23800 |
| Density | 1.137g/cm3 |
| Boiling Point | 399.5ºC at 760 mmHg |
| Storage Condition | room temperature |
| HTC | 2918300090 |
| PubChem ID | 3178878 |
| SMILES | Cc1ccc(C(=O)CCCC(=O)O)cc1 |
| InChI | InChI=1S/C12H14O3/c1-9-5-7-10(8-6-9)11(13)3-2-4-12(14)15/h5-8H,2-4H2,1H3,(H,14,15) |
| InChI Key | MCWLCBLXRSXGTF-UHFFFAOYSA-N |
| MSDS | msds/79130_1_833_85_2.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives. Supervision conditions:None. VAT: 17.0%. Tax rebate rate:9.0%. MFN tariff: 6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2,6-Difluoro-3-nitrobenzoicacid | 83141-10-0 | 2A-9079116 |
| 2,4,6-Trifluorobenzylamine | 214759-21-4 | 2A-9079122 |
| Diethyl(1-methylpropyl)malonate | 83-27-2 | 2A-9079123 |
| 4-Isopropylpicolinicacid | 83282-36-4 | 2A-0202059 |
| 4-Fluoro-3-hydroxy-benzoicacidmethylester | 214822-96-5 | 2A-9079127 |
| N-(2-Hydroxyethyl)-2-(4-isobutylphenyl)propanamide | 83394-44-9 | 2A-9079132 |
| 2-Bromo-4,5-difluorophenylaceticacid | 83502-07-6 | 2A-9079134 |
| N-Me-DL-Glu-OHHCL | 35989-16-3 | 2A-9079135 |
| 4,4,4-Trifluorobut-2-enol(cis) | 83706-98-3 | 2A-9079139 |
| 1-Methoxy-(perfluoro-2-methyl-1-propene) | 360-53-2 | 2A-9079144 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA