
CAS Number214759-21-4
Synonyms2,3-DIHYDROXY-3-(5-METHYL-1H-BENZOIMIDAZOL-2-YL)-PROPIONIC ACID; (2,4,6-Trifluorophenyl)methylamine; 2,4,6-Trifluorobenzyl amin; 2,4,6-Trifluorobenzenemethanamine; (2,4,6-Trifluorophenyl)methanamine; 1-(2,4,6-Trifluorophenyl)methanamine; 1-(2,4,6-Trifluorophenyl)methylamine; 2,4,6-Trifluorobenzylamine; Z1R BF DF FF
Molecular FormulaC7H6F3N
Molecular Weight161.13
Density1.3±0.1 g/cm3
Boiling Point164.8±35.0 °C at 760 mmHg
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 214759-21-4 |
| Catalog No. | 2A-9079122 |
| Chinese Name | 2,4,6-三氟苄胺 |
| Synonyms | 2,3-DIHYDROXY-3-(5-METHYL-1H-BENZOIMIDAZOL-2-YL)-PROPIONIC ACID; (2,4,6-Trifluorophenyl)methylamine; 2,4,6-Trifluorobenzyl amin; 2,4,6-Trifluorobenzenemethanamine; (2,4,6-Trifluorophenyl)methanamine; 1-(2,4,6-Trifluorophenyl)methanamine; 1-(2,4,6-Trifluorophenyl)methylamine; 2,4,6-Trifluorobenzylamine; Z1R BF DF FF |
| Molecular Formula | C7H6F3N |
| Molecular Weight | 161.13 |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 164.8±35.0 °C at 760 mmHg |
| Storage Condition | Storage method: airtight, cool, ventilated and dry |
| Packaging | III |
| HTC | 2921499090 |
| PubChem ID | 3213592 |
| SMILES | NCc1c(F)cc(F)cc1F |
| InChI | InChI=1S/C7H6F3N/c8-4-1-6(9)5(3-11)7(10)2-4/h1-2H,3,11H2 |
| InChI Key | RCHOKTKXVKKNBC-UHFFFAOYSA-N |
| Hazard Symbols | 8.0 |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2921499090 other aromatic monoamines and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Benzo[c][1,2,5]thiadiazol-4-ylmethanamine | 82382-52-3 | 2A-9079094 |
| 7,8-Difluoro-2,3-dihydro-3-methyl-[4H]-1,4-benzoxazine | 82419-33-8 | 2A-9079095 |
| 3-Fluoro-4-iodobenzoicacid | 825-98-9 | 2A-9079099 |
| Methyl3-bromo-4-fluorobenzoate | 82702-31-6 | 2A-9079102 |
| 2,6-Difluoro-3-nitrobenzoicacid | 83141-10-0 | 2A-9079116 |
| Diethyl(1-methylpropyl)malonate | 83-27-2 | 2A-9079123 |
| 4-Isopropylpicolinicacid | 83282-36-4 | 2A-0202059 |
| 4-Fluoro-3-hydroxy-benzoicacidmethylester | 214822-96-5 | 2A-9079127 |
| 5-(4-Methylphenyl)-5-oxovalericacid | 833-85-2 | 2A-9079130 |
| N-(2-Hydroxyethyl)-2-(4-isobutylphenyl)propanamide | 83394-44-9 | 2A-9079132 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA