CAS Number3556-83-0
SynonymsMFCD00082710; Methyl3-methoxy-4-methylbenzoate; 3-methoxy-4-methylbenzoic acid methyl ester; Benzoic acid, 3-methoxy-4-methyl-, methyl ester; methyl 3-methoxy-3-methyl benzoate; 3-Methoxy-p-toluic Acid Methyl Ester; methyl 4-methyl-3-methoxybenzoate; Methyl 3-methoxy-4-methylbenzoate; 4-Methyl-m-anisic Acid Methyl Ester; Methyl 3-Methoxy-p-toluate; Methyl 4-Methyl-m-anisate; 3-Methoxy-4-methyl-benzoesaeure-methylester
Molecular FormulaC10H12O3
Molecular Weight180.2
Density1.1±0.1 g/cm3
Boiling Point257.4±20.0 °C at 760 mmHg
Melting Point50-54 °C(lit.)
AppearanceWhite solid or colorless liquid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 3556-83-0 |
| Catalog No. | 2A-9078957 |
| Chinese Name | 3-甲氧基-4-甲基苯甲酸甲 |
| Synonyms | MFCD00082710; Methyl3-methoxy-4-methylbenzoate; 3-methoxy-4-methylbenzoic acid methyl ester; Benzoic acid, 3-methoxy-4-methyl-, methyl ester; methyl 3-methoxy-3-methyl benzoate; 3-Methoxy-p-toluic Acid Methyl Ester; methyl 4-methyl-3-methoxybenzoate; Methyl 3-methoxy-4-methylbenzoate; 4-Methyl-m-anisic Acid Methyl Ester; Methyl 3-Methoxy-p-toluate; Methyl 4-Methyl-m-anisate; 3-Methoxy-4-methyl-benzoesaeure-methylester |
| Molecular Formula | C10H12O3 |
| Molecular Weight | 180.2 |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 257.4±20.0 °C at 760 mmHg |
| Melting Point | 50-54 °C(lit.) |
| Appearance | White solid or colorless liquid |
| Storage Condition | Keep away from light, in a ventilated and dry plac |
| HTC | 2918990090 |
| PubChem ID | 6914029 |
| SMILES | COC(=O)c1ccc(C)c(OC)c1 |
| InChI | InChI=1S/C10H12O3/c1-7-4-5-8(10(11)13-3)6-9(7)12-2/h4-6H,1-3H3 |
| InChI Key | LLEXCSBUSVRBCA-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 3-(Methanesulfonyl)aniline | 35216-39-8 | 2A-9078943 |
| 6,7-Dimethoxy-2-methylquinazolin-4-ol | 35241-23-7 | 2A-9078944 |
| N-phenyl-4-methoxybenzylamine | 3526-43-0 | 2A-9078946 |
| Methyl3-bromo-4-methoxybenzoate | 35450-37-4 | 2A-9078953 |
| 3-Methoxy-4-methylbenzonitrile | 3556-60-3 | 2A-9078955 |
| 3-Hydroxy-4-methylbenzoicacidmethylester | 3556-86-3 | 2A-9078958 |
| [4-(Methylthio)phenyl]hydrazinehydrochloride | 35588-53-5 | 2A-9078960 |
| P-Tolylacetylchloride | 35675-44-6 | 2A-9078962 |
| (2-Chloroquinazolin-4-yl)-dimethylamine | 35691-16-8 | 2A-9078963 |
| 1,3,4,5-Tetrahydro-1,5-methano-2H-3-benzazepin-2-one | 357426-13-2 | 2A-9078965 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS