CAS Number3526-43-0
Synonyms4-methoxycinnamate; 4-methoxy-N-phenylbenzenemethanamin; 3-(4'-methoxyphenyl)propenoic acid; 4-Methoxyciamic acid; p-coumaric acid methyl ether; N-(4-methoxybenzyl)-N-phenylamine; (4-Methoxy-benzyl)-phenyl-amine; 3-(4-methoxyphenyl)acrylic acid; 4-METHOXY-N-PHENYLBENZYLAMINE; 4-Methoxy-N-phenylbenzenemethanamine; PMCA; N-(4-Methoxybenzyl)aniline
Molecular FormulaC14H15NO
Molecular Weight213.282
Density1.1±0.1 g/cm3
Boiling Point349.3±17.0 °C at 760 mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 3526-43-0 |
| Catalog No. | 2A-9078946 |
| Chinese Name | N-苯基-4-甲氧基苄胺 |
| Synonyms | 4-methoxycinnamate; 4-methoxy-N-phenylbenzenemethanamin; 3-(4'-methoxyphenyl)propenoic acid; 4-Methoxyciamic acid; p-coumaric acid methyl ether; N-(4-methoxybenzyl)-N-phenylamine; (4-Methoxy-benzyl)-phenyl-amine; 3-(4-methoxyphenyl)acrylic acid; 4-METHOXY-N-PHENYLBENZYLAMINE; 4-Methoxy-N-phenylbenzenemethanamine; PMCA; N-(4-Methoxybenzyl)aniline |
| Molecular Formula | C14H15NO |
| Molecular Weight | 213.282 |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 349.3±17.0 °C at 760 mmHg |
| Storage Condition | room temperature, dry |
| HTC | 2922299090 |
| PubChem ID | 3354851 |
| MDL Number | MFCD00025831 |
| SMILES | COc1ccc(CNc2ccccc2)cc1 |
| InChI | InChI=1S/C14H15NO/c1-16-14-9-7-12(8-10-14)11-15-13-5-3-2-4-6-13/h2-10,15H,11H2,1H3 |
| InChI Key | WRDZMZGYHVUYRU-UHFFFAOYSA-N |
| MSDS | msds/78946_1_3526_43_0.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 3-(4-Formylphenyl)propanoicacid | 34961-64-3 | 2A-9078935 |
| Piperidin-4-yl-pyrrolidin-1-yl-methanone | 35090-95-0 | 2A-9078936 |
| 4-Fluorophenylmagnesiumbromide | 352-13-6 | 2A-9078942 |
| 3-(Methanesulfonyl)aniline | 35216-39-8 | 2A-9078943 |
| 6,7-Dimethoxy-2-methylquinazolin-4-ol | 35241-23-7 | 2A-9078944 |
| Methyl3-bromo-4-methoxybenzoate | 35450-37-4 | 2A-9078953 |
| 3-Methoxy-4-methylbenzonitrile | 3556-60-3 | 2A-9078955 |
| Methyl3-methoxy-4-methylbenzoate | 3556-83-0 | 2A-9078957 |
| 3-Hydroxy-4-methylbenzoicacidmethylester | 3556-86-3 | 2A-9078958 |
| [4-(Methylthio)phenyl]hydrazinehydrochloride | 35588-53-5 | 2A-9078960 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS