
CAS Number20872-29-1
Synonyms4-Acetoxyphenoxy-acetic acid; 2-(4-acetoxyphenoxy)acetic acid; 4-Acetoxyphrnoxyaceticacid; (4-Acetoxyphenoxy)acetic acid; p-acetoxyphenoxyacetic acid
Molecular FormulaC10H10O5
Molecular Weight210.183
Density1.3±0.1 g/cm3
Boiling Point365.5±22.0 °C at 760 mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 20872-29-1 |
| Catalog No. | 2A-9078730 |
| Chinese Name | 4-乙氧基苯氧基乙酸 |
| Synonyms | 4-Acetoxyphenoxy-acetic acid; 2-(4-acetoxyphenoxy)acetic acid; 4-Acetoxyphrnoxyaceticacid; (4-Acetoxyphenoxy)acetic acid; p-acetoxyphenoxyacetic acid |
| Molecular Formula | C10H10O5 |
| Molecular Weight | 210.183 |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 365.5±22.0 °C at 760 mmHg |
| HTC | 2918990090 |
| PubChem ID | 32321831 |
| SMILES | CC(=O)Oc1ccc(OCC(=O)O)cc1 |
| InChI | InChI=1S/C10H10O5/c1-7(11)15-9-4-2-8(3-5-9)14-6-10(12)13/h2-5H,6H2,1H3,(H,12,13) |
| InChI Key | GEHROUVMFOQBMR-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Methylhydrogenphthalate | 4376-18-5 | 2A-9078711 |
| Phthalicacidmono-2-Ethylhexylester | 4376-20-9 | 2A-9078712 |
| 3-(4-Bromobenzoyl)pyrrolidin-2-one | 328546-97-0 | 2A-9078714 |
| 5-(3,4-Dimethoxyphenyl)-5-oxovalericacid | 4378-55-6 | 2A-9078716 |
| Methyl5-chloro-2-cyanobenzoate | 439117-38-1 | 2A-9078724 |
| 4-Nitrocatechol | 3316-09-4 | 2A-9078731 |
| 5-Bromo-2-Ethylbenzoicacid | 439937-55-0 | 2A-9078732 |
| 2-Bromo-1,1-dimethoxypropane | 33170-72-8 | 2A-9078733 |
| C-Isoxazol-5-yl-methylaminehydrochloride | 440099-32-1 | 2A-9078734 |
| 2-Aminobenzylamine | 4403-69-4 | 2A-9078738 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA