
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 4378-55-6 |
| Catalog No. | 2A-9078716 |
| Chinese Name | 5-(3,4-二甲氧基苯基)-5-氧戊酸 |
| Synonyms | MFCD00094346 |
| Molecular Formula | C13H16O5 |
| Molecular Weight | 252.269 |
| Density | 1.183g/cm3 |
| Boiling Point | 451.8ºC at 760 mmHg |
| Melting Point | 145-146ºC |
| Storage Condition | 2-8°C |
| HTC | 2918990090 |
| PubChem ID | 3185488 |
| MDL Number | MFCD00094346 |
| SMILES | COc1ccc(C(=O)CCCC(=O)O)cc1OC |
| InChI | InChI=1S/C13H16O5/c1-17-11-7-6-9(8-12(11)18-2)10(14)4-3-5-13(15)16/h6-8H,3-5H2,1-2H3,(H,15,16) |
| InChI Key | VCPFAIMGNLXMPO-UHFFFAOYSA-N |
| MSDS | msds/78716_1_4378_55_6.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 6-Bromo-3,4-dihydro-2(1H)-quinolinone | 3279-90-1 | 2A-9078707 |
| (5-Phenyl-4H-[1,2,4]triazol-3-yl)-aceticacid | 328084-14-6 | 2A-9078708 |
| Methylhydrogenphthalate | 4376-18-5 | 2A-9078711 |
| Phthalicacidmono-2-Ethylhexylester | 4376-20-9 | 2A-9078712 |
| 3-(4-Bromobenzoyl)pyrrolidin-2-one | 328546-97-0 | 2A-9078714 |
| Methyl5-chloro-2-cyanobenzoate | 439117-38-1 | 2A-9078724 |
| 4-Acetoxyphenoxyaceticacid | 20872-29-1 | 2A-9078730 |
| 4-Nitrocatechol | 3316-09-4 | 2A-9078731 |
| 5-Bromo-2-Ethylbenzoicacid | 439937-55-0 | 2A-9078732 |
| 2-Bromo-1,1-dimethoxypropane | 33170-72-8 | 2A-9078733 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA