
CAS Number3226-34-4
Synonyms1-(3-Chlor-2-hydroxy-phenyl)-aethanon; 1-(3-Chloro-2-hydroxyphenyl)ethan-1-one; 1-(3-Chloro-2-hydroxyphenyl)ethanone; 1-(3-chloro-2-hydroxy-phenyl)-ethanone
Molecular FormulaC8H7ClO2
Molecular Weight170.6
Density1.298g/cm3
Boiling Point247.1ºC at 760mmHg
Melting Point80ºC
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 3226-34-4 |
| Catalog No. | 2A-9078618 |
| Chinese Name | 1-(3-氯-2-羟苯基)乙基-1-酮 |
| Synonyms | 1-(3-Chlor-2-hydroxy-phenyl)-aethanon; 1-(3-Chloro-2-hydroxyphenyl)ethan-1-one; 1-(3-Chloro-2-hydroxyphenyl)ethanone; 1-(3-chloro-2-hydroxy-phenyl)-ethanone |
| Molecular Formula | C8H7ClO2 |
| Molecular Weight | 170.6 |
| Density | 1.298g/cm3 |
| Boiling Point | 247.1ºC at 760mmHg |
| Melting Point | 80ºC |
| Storage Condition | 2-8°C |
| HTC | 2914700090 |
| PubChem ID | 3211029 |
| SMILES | CC(=O)c1cccc(Cl)c1O |
| InChI | InChI=1S/C8H7ClO2/c1-5(10)6-3-2-4-7(9)8(6)11/h2-4,11H,1H3 |
| InChI Key | GBWVDQBTXFIIJF-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 7-Bromo-2H-benzo[b][1,4]oxazin-3(4H)-one | 321436-06-0 | 2A-9078603 |
| 8-Methoxy-1,2,3,4-tetrahydronaphtalene-2-carboxylicacid | 32178-63-5 | 2A-9078609 |
| 2-Chloro-3,5-difluorophenol | 206986-81-4 | 2A-9078611 |
| 4,5-DiMethyloxazol-2-amine | 45529-92-8 | 2A-9078615 |
| 2-(3-Methyl-1,2,4-oxadiazol-5-yl)phenol | 79349-23-8 | 2A-9078616 |
| 3-Ethylpentane-1,3-diol | 79388-50-4 | 2A-9078620 |
| Tert-butyl6-aminopyridin-2-ylcarbamate | 322690-31-3 | 2A-9078621 |
| 5-Methoxyisoxazol-3-amine | 3230-65-7 | 2A-9078626 |
| Piperidin-1-yl-aceticacid | 3235-67-4 | 2A-9078630 |
| 3-Fluoro-4-bromoanisole | 456-50-4 | 2A-9078631 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA