
CAS Number32178-63-5
SynonymsMFCD01075657; 2-Carboxy-8-methoxy-1,2,3,4-tetrahydronaphthalene; 8-Methoxy-1,2,3,4-tetrahydronaphtalene-2-carboxylic acid; 8-methoxy-1,2,3,4-tetrahydro-naphthalene-2-carboxylic acid
Molecular FormulaC12H14O3
Molecular Weight206.23800
Density1.195g/cm3
Boiling Point397.3ºC at 760mmHg
Melting Point141-143ºC
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 32178-63-5 |
| Catalog No. | 2A-9078609 |
| Chinese Name | 8-甲氧基-1,2,3,4-四氢萘-2-甲酸 |
| Synonyms | MFCD01075657; 2-Carboxy-8-methoxy-1,2,3,4-tetrahydronaphthalene; 8-Methoxy-1,2,3,4-tetrahydronaphtalene-2-carboxylic acid; 8-methoxy-1,2,3,4-tetrahydro-naphthalene-2-carboxylic acid |
| Molecular Formula | C12H14O3 |
| Molecular Weight | 206.23800 |
| Density | 1.195g/cm3 |
| Boiling Point | 397.3ºC at 760mmHg |
| Melting Point | 141-143ºC |
| Storage Condition | Keep the container sealed and stored in a cool, dr |
| HTC | 2918990090 |
| PubChem ID | 4937181 |
| SMILES | COc1cccc2c1CC(C(=O)O)CC2 |
| InChI | InChI=1S/C12H14O3/c1-15-11-4-2-3-8-5-6-9(12(13)14)7-10(8)11/h2-4,9H,5-7H2,1H3,(H,13,14) |
| InChI Key | VOAFGTBETRJDPU-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 4'-Phenoxyphenylacetylene | 4200-06-0 | 2A-9078597 |
| 2-(1-AminoEthyl)-4-methyl-5(4H)-oxazolone | 791050-65-2 | 2A-9078598 |
| 5-Bromo-indan-2-ylaminehydrobromidesalt | 321352-52-7 | 2A-9078599 |
| 3-Fluoro-5-(pyridin-3-yloxy)aniline | 791644-59-2 | 2A-9078601 |
| 7-Bromo-2H-benzo[b][1,4]oxazin-3(4H)-one | 321436-06-0 | 2A-9078603 |
| 2-Chloro-3,5-difluorophenol | 206986-81-4 | 2A-9078611 |
| 4,5-DiMethyloxazol-2-amine | 45529-92-8 | 2A-9078615 |
| 2-(3-Methyl-1,2,4-oxadiazol-5-yl)phenol | 79349-23-8 | 2A-9078616 |
| 1-(3-Chloro-2-hydroxyphenyl)ethan-1-one | 3226-34-4 | 2A-9078618 |
| 3-Ethylpentane-1,3-diol | 79388-50-4 | 2A-9078620 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA