
CAS Number3190-71-4
SynonymsBenzyl 3-[(4S)-2,5-dioxo-1,3-oxazolidin-4-yl]propanoate; H-GLU(OBZL)-NCA; Glutamic acid,5-benzyl ester,NCA; L-benzylglutamate NCA; Glu(OBzl)NCA; 5-Benzyl L-glutamate N-carboxyanhydride; L-Glu(Obzl)-NCA
Molecular FormulaC13H13NO5
Molecular Weight263.25
Density1.293
Melting Point97-98 ºC
AppearanceSolid;White to Light yellow powder to crystal
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 3190-71-4 |
| Catalog No. | 2A-9078533 |
| Chinese Name | 谷氨酸 5-苄酯 N-羧基环内酸酐 |
| Synonyms | Benzyl 3-[(4S)-2,5-dioxo-1,3-oxazolidin-4-yl]propanoate; H-GLU(OBZL)-NCA; Glutamic acid,5-benzyl ester,NCA; L-benzylglutamate NCA; Glu(OBzl)NCA; 5-Benzyl L-glutamate N-carboxyanhydride; L-Glu(Obzl)-NCA |
| Molecular Formula | C13H13NO5 |
| Molecular Weight | 263.25 |
| Density | 1.293 |
| Melting Point | 97-98 ºC |
| Appearance | Solid;White to Light yellow powder to crystal |
| Storage Condition | <0°C; store in inert gas; avoid air, heat |
| HTC | 2934999090 |
| PubChem ID | 14770819 |
| SMILES | O=C(CCC1NC(=O)OC1=O)OCc1ccccc1 |
| InChI | InChI=1S/C13H13NO5/c15-11(18-8-9-4-2-1-3-5-9)7-6-10-12(16)19-13(17)14-10/h1-5,10H,6-8H2,(H,14,17)/t10-/m0/s1 |
| InChI Key | UGCBVSDSTGUPBC-JTQLQIEISA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Allylamino-aceticacidhydrochloride | 3182-77-2 | 2A-9078527 |
| Cis-1-bromo-1-butene | 31844-98-1 | 2A-9078528 |
| 4H-Chromeno[4,3-d][1,3]thiazol-2-amine | 31877-68-6 | 2A-9078529 |
| Cis-2-amino-cyclopentanolhydrochloride | 31889-37-9 | 2A-9078530 |
| Methyl4-chloro-2-nitrobenzoate | 42087-80-9 | 2A-9078531 |
| Copper(I)trifluoromethanesulfonate benzene complex | 42152-46-5 | 2A-9078534 |
| Phosphoricacidtri-o-tolylester | 78-30-8 | 2A-9078535 |
| 1-(2-Nitro-phenyl)-cyclopropanecarboxylicacid | 422280-53-3 | 2A-9078536 |
| Ethyl-phosphonicacidDiethylester | 78-38-6 | 2A-9078537 |
| 4-Chlorobenzylaminehydrochloride | 42365-43-5 | 2A-9078538 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA