
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 42860-02-6 |
| Catalog No. | 2A-9078502 |
| Chinese Name | 3-溴-5-氯苯甲酸 |
| Synonyms | 3-Bromo-5-chlorobenzoic acid; QVR CG EE |
| Molecular Formula | C7H4BrClO2 |
| Molecular Weight | 235.46 |
| Density | 1.8±0.1 g/cm3 |
| Boiling Point | 332.0±27.0 °C at 760 mmHg |
| Melting Point | 190-192ºC |
| Appearance | White to light yellow powder |
| Storage Condition | Keep Cold |
| HTC | 2916399090 |
| PubChem ID | 29203679 |
| SMILES | O=C(O)c1cc(Cl)cc(Br)c1 |
| InChI | InChI=1S/C7H4BrClO2/c8-5-1-4(7(10)11)2-6(9)3-5/h1-3H,(H,10,11) |
| InChI Key | PBRRUJWXRUGGAW-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Purity: 98.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified 3-Bromo-5-chlorobenzoic acid |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 3-Cyanopropionicacidmethylester | 4107-62-4 | 2A-9078487 |
| Methyl3-isocyanatobenzoate | 41221-47-0 | 2A-9078491 |
| 1-Iodo-2-methyl-3-nitrobenzene | 41252-98-6 | 2A-9078495 |
| 3-Nitro-5-iodobenzotrifluoride | 41253-01-4 | 2A-9078496 |
| N-(4-Bromophenyl)methanesulfonamide | 4284-50-8 | 2A-9078500 |
| 2-Bromo-4-methylbenzonitrile | 42872-73-1 | 2A-9078505 |
| 4-Cyclopropylbenzenamine | 3158-71-2 | 2A-9078506 |
| 3-Ethyl-3-hydroxypentylmethanesulfonate | 428871-08-3 | 2A-9078508 |
| N-(4-Bromophenyl)-3-phenylpropanamide | 316146-27-7 | 2A-9078509 |
| Methyl3-(piperazin-1-yl)propanoate | 43032-40-2 | 2A-9078514 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA