
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 41252-98-6 |
| Catalog No. | 2A-9078495 |
| Chinese Name | 2-碘-6-硝基甲苯 |
| Synonyms | 3-nitro-2-methyliodobenzene; 1-Iodo-2-methyl-3-nitrobenzene; 2-Iodo-6-nitrotoluene; 2-Methyl-3-nitro-iodobenzene; 6-iodo-2-nitrotoluene |
| Molecular Formula | C8H6F3I1 |
| Molecular Weight | 286.04 |
| Density | 1.9±0.1 g/cm3 |
| Boiling Point | 288.9±20.0 °C at 760 mmHg |
| Storage Condition | Room temperature, protected from light, dry and se |
| HTC | 2904909090 |
| PubChem ID | 16638301 |
| MDL Number | MFCD09800791 |
| SMILES | Cc1c(I)cccc1[N+](=O)[O-] |
| InChI | InChI=1S/C7H6INO2/c1-5-6(8)3-2-4-7(5)9(10)11/h2-4H,1H3 |
| InChI Key | ZVAKFJFOGUFJON-UHFFFAOYSA-N |
| MSDS | msds/78495_1_41252_98_6.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| [2-4(Methoxy-phenyl)-Ethyl]-methyl-amine | 4091-50-3 | 2A-9078481 |
| 1-(2-Amino-4,5-dimethoxyphenyl)ethanone | 4101-30-8 | 2A-9078485 |
| 3-(Methylthio)propylamine | 4104-45-4 | 2A-9078486 |
| 3-Cyanopropionicacidmethylester | 4107-62-4 | 2A-9078487 |
| Methyl3-isocyanatobenzoate | 41221-47-0 | 2A-9078491 |
| 3-Nitro-5-iodobenzotrifluoride | 41253-01-4 | 2A-9078496 |
| N-(4-Bromophenyl)methanesulfonamide | 4284-50-8 | 2A-9078500 |
| 3-Bromo-5-chlorobenzoicacid | 42860-02-6 | 2A-9078502 |
| 2-Bromo-4-methylbenzonitrile | 42872-73-1 | 2A-9078505 |
| 4-Cyclopropylbenzenamine | 3158-71-2 | 2A-9078506 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA