
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 4073-35-2 |
| Catalog No. | 2A-9078476 |
| Chinese Name | 3,5-二溴-4-甲氧基苯甲酸 |
| Synonyms | 3,5-dibromo-4-methoxybenzoic acid; MFCD00016511 |
| Molecular Formula | C8H6Br2O3 |
| Molecular Weight | 309.94 |
| Density | 1.957g/cm3 |
| Boiling Point | 365.2ºC at 760 mmHg |
| Melting Point | 224 °C |
| Storage Condition | Keep away from light, in a ventilated and dry plac |
| HTC | 2918990090 |
| PubChem ID | 3184931 |
| SMILES | COc1c(Br)cc(C(=O)O)cc1Br |
| InChI | InChI=1S/C8H6Br2O3/c1-13-7-5(9)2-4(8(11)12)3-6(7)10/h2-3H,1H3,(H,11,12) |
| InChI Key | NAHPGFGVWWKSFU-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Sarcosine-N-dithiocarbamate | 40520-03-4 | 2A-9078465 |
| Cyclopentane-1,3-dicarboxylicacid | 4056-78-4 | 2A-9078467 |
| N-methyl-1-(1-Methylpiperidin-4-yl)methanamine | 405928-19-0 | 2A-9078469 |
| 1-(1-BromoEthyl)-2-Fluorobenzene | 405931-46-6 | 2A-9078470 |
| 3,5-Dibromo-2-hydroxybenzonitrile | 40718-08-9 | 2A-9078475 |
| 3-(1H-Pyrrol-2-yl)propanoicacid | 408309-29-5 | 2A-9078478 |
| 2-Methyl-sulphanyl-4,5-dihydrothiazolinehydroiodide | 40836-94-0 | 2A-9078479 |
| 3-Bromo-phenylhydrazine | 40887-80-7 | 2A-9078480 |
| [2-4(Methoxy-phenyl)-Ethyl]-methyl-amine | 4091-50-3 | 2A-9078481 |
| 1-(2-Amino-4,5-dimethoxyphenyl)ethanone | 4101-30-8 | 2A-9078485 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA