
CAS Number40718-08-9
Synonyms3,5-dibromo-2-hydroxy-benzonitrile; 4.6-Dibrom-2-cyan-phenol; 3,5-Dibrom-2-hydroxy-benzonitril; 3.5-Dibrom-salicylsaeure-nitril
Molecular FormulaC7H3Br2NO
Molecular Weight276.91
Density2.24g/cm3
Boiling Point275.4ºC at 760 mmHg
AppearanceWhite to yellow crystal or powder
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 40718-08-9 |
| Catalog No. | 2A-9078475 |
| Chinese Name | 3,5-二溴-2-羟基苯甲腈 |
| Synonyms | 3,5-dibromo-2-hydroxy-benzonitrile; 4.6-Dibrom-2-cyan-phenol; 3,5-Dibrom-2-hydroxy-benzonitril; 3.5-Dibrom-salicylsaeure-nitril |
| Molecular Formula | C7H3Br2NO |
| Molecular Weight | 276.91 |
| Density | 2.24g/cm3 |
| Boiling Point | 275.4ºC at 760 mmHg |
| Appearance | White to yellow crystal or powder |
| Storage Condition | Room temperature, sealed, dry, protected from ligh |
| HTC | 2926909090 |
| PubChem ID | 3219911 |
| SMILES | N#Cc1cc(Br)cc(Br)c1O |
| InChI | InChI=1S/C7H3Br2NO/c8-5-1-4(3-10)7(11)6(9)2-5/h1-2,11H |
| InChI Key | IZOWHVRXNOVUGY-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS:2926909090 other nitrile-function compounds VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| N-[[4-(dimethylamino)phenyl]methyl]-1,2,3,4-tetrahydro-7-methoxy-n-[4-(1-methylEthyl)phenyl]-1-naphthalenecarboxamidehydrochloride | 405098-33-1 | 2A-9078462 |
| Sarcosine-N-dithiocarbamate | 40520-03-4 | 2A-9078465 |
| Cyclopentane-1,3-dicarboxylicacid | 4056-78-4 | 2A-9078467 |
| N-methyl-1-(1-Methylpiperidin-4-yl)methanamine | 405928-19-0 | 2A-9078469 |
| 1-(1-BromoEthyl)-2-Fluorobenzene | 405931-46-6 | 2A-9078470 |
| 3,5-Dibromo-4-methoxybenzoicacid | 4073-35-2 | 2A-9078476 |
| 3-(1H-Pyrrol-2-yl)propanoicacid | 408309-29-5 | 2A-9078478 |
| 2-Methyl-sulphanyl-4,5-dihydrothiazolinehydroiodide | 40836-94-0 | 2A-9078479 |
| 3-Bromo-phenylhydrazine | 40887-80-7 | 2A-9078480 |
| [2-4(Methoxy-phenyl)-Ethyl]-methyl-amine | 4091-50-3 | 2A-9078481 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA