
CAS Number29682-39-1
Synonyms3-chloro-4-bromonitrobenzene; EINECS 249-773-8; 4-Bromo-3-chloronitrobenzene; 1-bromo-2-chloro-4-nitro-benzene; 2-chloro-4-nitrobromobenzene; MFCD00051514; 1-Brom-2-chlor-4-nitro-benzol
Molecular FormulaC6H3BrClNO2
Molecular Weight175.54
Density1.827 g/cm3
Boiling Point282.2ºC at 760 mmHg
Melting Point59-62ºC
Appearancesolid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 29682-39-1 |
| Catalog No. | 2A-9078337 |
| Chinese Name | 1-溴-2-氯-4-硝基苯 |
| Synonyms | 3-chloro-4-bromonitrobenzene; EINECS 249-773-8; 4-Bromo-3-chloronitrobenzene; 1-bromo-2-chloro-4-nitro-benzene; 2-chloro-4-nitrobromobenzene; MFCD00051514; 1-Brom-2-chlor-4-nitro-benzol |
| Molecular Formula | C6H3BrClNO2 |
| Molecular Weight | 175.54 |
| Density | 1.827 g/cm3 |
| Boiling Point | 282.2ºC at 760 mmHg |
| Melting Point | 59-62ºC |
| Appearance | solid |
| Storage Condition | Keep the container sealed and stored in a cool, dr |
| Packaging | III |
| HTC | 2904909090 |
| PubChem ID | 329778640 |
| MDL Number | MFCD00042211 |
| SMILES | [O-][N+](=O)c1ccc(Cl)cc1F |
| InChI | 1S/C6H3ClFNO2/c7-4-1-2-6(9(10)11)5(8)3-4/h1-3H |
| InChI Key | PTCPUGKKWNMITF-UHFFFAOYSA-N |
| UNSPSC | 12352200 |
| MSDS | msds/78337_1_29682_39_1.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 5-Propyl-2-thiouracil | 2954-52-1 | 2A-9078316 |
| 1-Phenylpiperazin-2-one | 29620-62-0 | 2A-9078321 |
| 2-Bromo-1-(4-chloro-3-Methylphenyl)ethanone | 205178-80-9 | 2A-9078326 |
| 5-Ethylpicolinicacid | 770-08-1 | 2A-9078330 |
| Carbamicacid,[trans-4-[[(1,1-dimethylethoxy)carbonyl]amino]cyclohexyl]-,phenylmethylester | 296270-92-3 | 2A-9078334 |
| (RS)-2-Amino-1,1,1-trifluoropropanehydrochloride | 2968-32-3 | 2A-9078345 |
| Tetrahydrothiopyran-4-ol | 29683-23-6 | 2A-9078347 |
| 2-(1H-pyrrol-1-yl)-1-ethanamine | 29709-35-1 | 2A-9078349 |
| 2-Chloro-N,N-dimethyl-5-phenylpyrimidin-4-amine | 771555-68-1 | 2A-9078350 |
| 1-Bromo-4-(phenoxymethyl)benzene | 20600-22-0 | 2A-9078359 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA