
CAS Number205178-80-9
Synonyms2-Brom-1-(4-chlor-3-methyl-phenyl)-aethanon; 4-Chloro-3-methylphenacyl bromide; 2-bromo-1-(4-chloro-3-methyl-phenyl)-ethanone; 2-BROMO-1-(4-CHLORO-3-METHYLPHENYL)ETHAN-1-ONE; 2-Bromo-1-(4-chloro-3-methylphenyl)ethan-1-one
Molecular FormulaC9H8BrClO
Molecular Weight277.54
Density1.524g/cm3
Boiling Point312.3ºC at 760mmHg
Melting Point52ºC
Appearancesolid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 205178-80-9 |
| Catalog No. | 2A-9078326 |
| Chinese Name | 2-溴-1-(4-氯-3-甲基苯基)乙酮 |
| Synonyms | 2-Brom-1-(4-chlor-3-methyl-phenyl)-aethanon; 4-Chloro-3-methylphenacyl bromide; 2-bromo-1-(4-chloro-3-methyl-phenyl)-ethanone; 2-BROMO-1-(4-CHLORO-3-METHYLPHENYL)ETHAN-1-ONE; 2-Bromo-1-(4-chloro-3-methylphenyl)ethan-1-one |
| Molecular Formula | C9H8BrClO |
| Molecular Weight | 277.54 |
| Density | 1.524g/cm3 |
| Boiling Point | 312.3ºC at 760mmHg |
| Melting Point | 52ºC |
| Appearance | solid |
| Storage Condition | 2-8°C, sealed, dry |
| HTC | 2914700090 |
| PubChem ID | 329816044 |
| MDL Number | MFCD03425157 |
| SMILES | COc1cc(C)c(Cl)cc1C(=O)CBr |
| InChI | 1S/C10H10BrClO2/c1-6-3-10(14-2)7(4-8(6)12)9(13)5-11/h3-4H,5H2,1-2H3 |
| InChI Key | BYBYETVLFBNBBH-UHFFFAOYSA-N |
| NACRES Code | NA.21 |
| UNSPSC | 12352200 |
| MSDS | msds/78326_1_205178_80_9.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 6-Methyl-heptanoate | 29355-14-4 | 2A-9078302 |
| Benzyloxyurea | 2048-50-2 | 2A-9078310 |
| 4-Methyl-3-oxo-pentanenitrile | 29509-06-6 | 2A-9078313 |
| 5-Propyl-2-thiouracil | 2954-52-1 | 2A-9078316 |
| 1-Phenylpiperazin-2-one | 29620-62-0 | 2A-9078321 |
| 5-Ethylpicolinicacid | 770-08-1 | 2A-9078330 |
| Carbamicacid,[trans-4-[[(1,1-dimethylethoxy)carbonyl]amino]cyclohexyl]-,phenylmethylester | 296270-92-3 | 2A-9078334 |
| 1-Bromo-2-chloro-4-nitrobenzene | 29682-39-1 | 2A-9078337 |
| (RS)-2-Amino-1,1,1-trifluoropropanehydrochloride | 2968-32-3 | 2A-9078345 |
| Tetrahydrothiopyran-4-ol | 29683-23-6 | 2A-9078347 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA